CAS 612-20-4
:2-(Hydroxymethyl)benzoic acid
Description:
2-(Hydroxymethyl)benzoic acid, also known as salicylic acid, is an aromatic carboxylic acid characterized by the presence of both a hydroxymethyl group and a carboxylic acid group attached to a benzene ring. This compound typically appears as a white crystalline solid and is soluble in water, alcohol, and ether, reflecting its polar functional groups. It exhibits acidic properties due to the carboxylic acid moiety, allowing it to donate protons in solution. The hydroxymethyl group enhances its reactivity, making it useful in various chemical syntheses. Additionally, 2-(Hydroxymethyl)benzoic acid is known for its applications in pharmaceuticals, particularly in the formulation of anti-inflammatory and analgesic medications. It also serves as a precursor in the synthesis of various derivatives used in the cosmetic and agricultural industries. The compound's structure contributes to its ability to form hydrogen bonds, influencing its physical properties and interactions with biological systems. Overall, 2-(Hydroxymethyl)benzoic acid is a versatile compound with significant industrial and medicinal relevance.
Formula:C8H8O3
InChI:InChI=1/C8H8O3/c9-5-6-3-1-2-4-7(6)8(10)11/h1-4,9H,5H2,(H,10,11)
InChI key:InChIKey=MGMNPSAERQZUIM-UHFFFAOYSA-N
SMILES:C(O)C1=C(C(O)=O)C=CC=C1
Synonyms:- 2-Carboxybenzyl alcohol
- Benzoic acid, 2-(hydroxymethyl)-
- Benzoic acid, 2-(hydroxymethyl)- (9CI)
- Nsc 30638
- alpha-Hydroxy-o-toluic acid
- o-(Hydroxymethyl)benzoic acid
- o-Carboxybenzyl alcohol
- o-Toluic acid, alpha-hydroxy- (8CI)
- o-Toluic acid, α-hydroxy-
- α-Hydroxy-o-toluic acid
- 2-(Hydroxymethyl)benzoic acid
- Butylphthalide Impurity 5
- Olopatadine Impurity 2
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-(Hydroxymethyl)benzoic acid
CAS:Formula:C8H8O3Purity:95%Color and Shape:Solid, PowderMolecular weight:152.1492-hydroxymethyl benzoic acid
CAS:<p>2-hydroxymethyl benzoic acid</p>Purity:≥98%Molecular weight:152.15g/mol2-(Hydroxymethyl)benzoic acid
CAS:2-(Hydroxymethyl)benzoic acidPurity:98%Molecular weight:152.15g/mol2-hydroxymethyl benzoic acid
CAS:<p>2-hydroxymethyl benzoic acid is a principal metabolite of the phthalidyl moiety in man.</p>Formula:C8H8O3Purity:98.36%Color and Shape:SolidMolecular weight:152.152-(Hydroxymethyl)benzoic acid
CAS:<p>2-(Hydroxymethyl)benzoic acid is a molecule that can be found in the human liver. It is a metabolite of the drug 2-hydroxybenzoic acid, which inhibits bacterial growth by binding to DNA-dependent RNA polymerase, thereby preventing transcription and replication. The high frequency of human activity has been shown using a patch-clamp technique on human erythrocytes. This active form is metabolized through a number of metabolic transformations, including hydrolysis by esterases or glucuronidases, oxidation by cytochrome P450 enzymes, reduction by glutathione reductase, or conjugation with glucuronic acid. 2-(Hydroxymethyl)benzoic acid also specifically binds to markers expressed at high levels in Mycobacterium tuberculosis strains (e.g., ESX-1 secretion system protein) and inhibits cell growth in culture.</p>Formula:C8H8O3Purity:Min. 95%Molecular weight:152.15 g/mol



