CymitQuimica logo

CAS 61255-82-1

:

3-(5-Amino-3-methyl-1H-pyrazol-1-yl)propanenitrile

Description:
3-(5-Amino-3-methyl-1H-pyrazol-1-yl)propanenitrile, with the CAS number 61255-82-1, is an organic compound characterized by its pyrazole ring structure, which contributes to its biological activity. This compound features an amino group and a nitrile functional group, which can influence its reactivity and solubility. The presence of the pyrazole moiety often suggests potential applications in pharmaceuticals, particularly in the development of anti-inflammatory or anti-cancer agents. The compound is typically a solid at room temperature and may exhibit moderate to high polarity due to the functional groups present. Its synthesis usually involves multi-step organic reactions, and it may be characterized using techniques such as NMR spectroscopy, mass spectrometry, and infrared spectroscopy to confirm its structure and purity. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, making it important to consider these conditions in practical applications. Overall, 3-(5-Amino-3-methyl-1H-pyrazol-1-yl)propanenitrile is a compound of interest in medicinal chemistry and related fields.
Formula:C7H10N4
InChI:InChI=1S/C7H10N4/c1-6-5-7(9)11(10-6)4-2-3-8/h5H,2,4,9H2,1H3
InChI key:GLVQDYSGMRVBBV-UHFFFAOYSA-N
SMILES:CC1=NN(C(=C1)N)CCC#N
Synonyms:
  • 1H-pyrazole-1-propanenitrile, 5-amino-3-methyl-
  • 3-(5-Amino-3-methyl-pyrazol-1-yl)-propionitrile
  • 1H-Pyrazole-1-propanenitrile,5-amino-3-methyl-(9CI)
Found 2 products.