CymitQuimica logo

CAS 61260-15-9

:

(3-Oxo-1,3-dihydroisobenzofuran-1-yl)phosphonic acid dimethyl ester

Description:
(3-Oxo-1,3-dihydroisobenzofuran-1-yl)phosphonic acid dimethyl ester, with CAS number 61260-15-9, is a chemical compound that features a phosphonic acid moiety esterified with dimethyl groups. This compound is characterized by its unique structure, which includes a bicyclic isobenzofuran framework and a phosphonic acid functional group, contributing to its potential reactivity and applications in various chemical processes. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the phosphonic acid group suggests potential applications in agriculture as a plant growth regulator or in the synthesis of organophosphorus compounds. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Its stability and solubility in organic solvents can facilitate its use in synthetic pathways. However, specific handling and safety measures should be observed due to the potential toxicity associated with phosphonic acid derivatives.
Formula:C10H11O5P
InChI:InChI=1S/C10H11O5P/c1-13-16(12,14-2)10-8-6-4-3-5-7(8)9(11)15-10/h3-6,10H,1-2H3
InChI key:KEKUNQAVGWOYDW-UHFFFAOYSA-N
SMILES:COP(=O)(C1C2=CC=CC=C2C(=O)O1)OC
Synonyms:
  • Dimethyl 1,3-Dihydro-3-Oxoisobenzofuran-1-Yl-1-Phosphonate
  • 3-Oxo-1,3-Dihydroisobenzofuran-1-Ylphosphonic Acid
  • Dimethyl 3-oxo-1,3-dihydroisobenzofuran-1-ylphosphonate
Found 6 products.