CymitQuimica logo

CAS 61271-84-9

:

1,3,8-Triazaspiro[4.5]decan-4-one, 1-(4-chlorophenyl)-

Description:
1,3,8-Triazaspiro[4.5]decan-4-one, 1-(4-chlorophenyl)-, identified by CAS number 61271-84-9, is a chemical compound characterized by its unique spirocyclic structure, which incorporates a triazine moiety. This compound features a spiro connection between a decanone framework and a triazole ring, contributing to its distinctive three-dimensional geometry. The presence of a 4-chlorophenyl group enhances its lipophilicity and may influence its biological activity. Typically, compounds of this nature exhibit a range of properties, including potential pharmacological activities, making them of interest in medicinal chemistry. The triazine ring can participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, which may be relevant for further functionalization. Additionally, the compound's stability and solubility can vary based on the substituents present, affecting its application in various fields such as drug development or materials science. Overall, 1,3,8-Triazaspiro[4.5]decan-4-one, 1-(4-chlorophenyl)- represents a class of compounds with potential utility in diverse chemical and biological applications.
Formula:C13H16ClN3O
InChI:InChI=1S/C13H16ClN3O/c14-10-1-3-11(4-2-10)17-9-16-12(18)13(17)5-7-15-8-6-13/h1-4,15H,5-9H2,(H,16,18)
InChI key:PSTZLFWHHJKOJF-UHFFFAOYSA-N
SMILES:C1CNCCC12C(=O)NCN2C3=CC=C(C=C3)Cl
Found 1 products.