CymitQuimica logo

CAS 61283-60-1

:

Butanoic acid, 4-oxo-4-(propylamino)-

Description:
Butanoic acid, 4-oxo-4-(propylamino)-, also known by its CAS number 61283-60-1, is an organic compound characterized by its carboxylic acid functional group and an amine substituent. This compound features a butanoic acid backbone, which consists of a four-carbon chain with a carboxylic acid (-COOH) at one end. The presence of a ketone group (4-oxo) indicates that there is a carbonyl (C=O) group located at the fourth carbon of the chain. The propylamino group suggests that a propyl chain is attached to a nitrogen atom, which is further connected to the butanoic acid structure. This compound is likely to exhibit properties typical of carboxylic acids, such as acidity and the ability to form hydrogen bonds, which can influence its solubility in water and other solvents. Additionally, the presence of the amine group may impart basic characteristics, allowing for potential interactions in biological systems or applications in pharmaceuticals. Overall, this compound's unique structure may contribute to its reactivity and potential uses in various chemical applications.
Formula:C7H13NO3
InChI:InChI=1S/C7H13NO3/c1-2-5-8-6(9)3-4-7(10)11/h2-5H2,1H3,(H,8,9)(H,10,11)
InChI key:NYGTWXWGPWMMJX-UHFFFAOYSA-N
SMILES:CCCNC(=O)CCC(=O)O
Found 2 products.