CymitQuimica logo

CAS 612845-45-1

:

(3-bromo-5-methoxy-4-pyridyl)boronic acid

Description:
(3-Bromo-5-methoxy-4-pyridyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyridine ring. This compound features a bromine atom and a methoxy group at specific positions on the pyridine, which influences its reactivity and solubility. The boronic acid moiety is known for its ability to form reversible covalent bonds with diols, making it valuable in various applications, including organic synthesis and medicinal chemistry. The presence of the bromine atom can enhance electrophilicity, while the methoxy group can provide electron-donating effects, potentially affecting the compound's reactivity and interaction with biological targets. This compound may be utilized in the development of pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Its unique structural features contribute to its potential utility in cross-coupling reactions and as a ligand in coordination chemistry. Overall, (3-bromo-5-methoxy-4-pyridyl)boronic acid exemplifies the versatility of boronic acids in chemical research and applications.
Formula:C6H7BBrNO3
InChI:InChI=1/C6H7BBrNO3/c1-12-5-3-9-2-4(8)6(5)7(10)11/h2-3,10-11H,1H3
InChI key:OXIFBQMTJUAUNR-UHFFFAOYSA-N
SMILES:COc1cncc(c1B(O)O)Br
Synonyms:
  • (3-Bromo-5-methoxypyridin-4-yl)boronic acid
  • boronic acid, B-(3-bromo-5-methoxy-4-pyridinyl)-
Found 3 products.