CAS 61315-63-7
:a-Isothiocyanato-DL-g-butyrolactone
Description:
α-Isothiocyanato-DL-γ-butyrolactone is a chemical compound characterized by the presence of an isothiocyanate functional group attached to a γ-butyrolactone structure. This compound typically exhibits a polar nature due to the presence of the isothiocyanate group, which can engage in nucleophilic reactions. It is a colorless to pale yellow liquid or solid, depending on the temperature and purity. The compound is known for its reactivity, particularly in forming thioureas and other derivatives through reactions with amines and alcohols. It may also exhibit biological activity, making it of interest in medicinal chemistry and agricultural applications. The presence of the lactone ring contributes to its stability and potential for ring-opening reactions under certain conditions. As with many isothiocyanates, it may possess pungent odors and should be handled with care due to potential toxicity. Overall, α-Isothiocyanato-DL-γ-butyrolactone is a versatile compound with applications in various fields, including organic synthesis and pharmacology.
Formula:C5H5NO2S
InChI:InChI=1/C5H5NO2S/c7-5-4(6-3-9)1-2-8-5/h4H,1-2H2
InChI key:MSBPBCHCQJBHNC-UHFFFAOYSA-N
SMILES:C1COC(=O)C1N=C=S
Synonyms:- alpha-Isothiocyanato-gamma-butyrolactone
- 3-isothiocyanatodihydrofuran-2(3H)-one
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
α-Isothiocyanato-DL-γ-butyrolactone
CAS:α-Isothiocyanato-DL-γ-butyrolactone
Molecular weight:143.1637g/mol
