CymitQuimica logo

CAS 61324-89-8

:

Benzene, 4-(difluoromethyl)-1-fluoro-2-nitro-

Description:
Benzene, 4-(difluoromethyl)-1-fluoro-2-nitro- is an aromatic compound characterized by a benzene ring substituted with a difluoromethyl group, a fluorine atom, and a nitro group. The presence of these substituents influences its chemical properties and reactivity. The difluoromethyl group introduces significant electronegativity, which can affect the compound's polarity and potential interactions with other molecules. The nitro group is known for its strong electron-withdrawing properties, which can enhance the compound's reactivity in electrophilic aromatic substitution reactions. Additionally, the fluorine atom contributes to the overall stability and lipophilicity of the molecule. This compound may exhibit unique physical properties, such as a specific boiling point and solubility characteristics, influenced by its functional groups. Due to its structure, it may also have applications in various fields, including pharmaceuticals and agrochemicals, although specific uses would depend on further research into its biological activity and environmental impact. Safety data should be consulted, as nitro compounds can be hazardous.
Formula:C7H4F3NO2
InChI:InChI=1S/C7H4F3NO2/c8-5-2-1-4(7(9)10)3-6(5)11(12)13/h1-3,7H
InChI key:ADPIQVYGOJQOFD-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1C(F)F)[N+](=O)[O-])F
Synonyms:
  • 1-(Difluoromethyl)-4-Fluoro-3-nitrobenzene
Found 5 products.