CymitQuimica logo

CAS 61324-97-8

:

Benzene, 2-fluoro-1-nitro-3-(trifluoromethyl)-

Description:
Benzene, 2-fluoro-1-nitro-3-(trifluoromethyl)-, also known by its CAS number 61324-97-8, is an aromatic compound characterized by a benzene ring substituted with a fluorine atom, a nitro group, and a trifluoromethyl group. The presence of these substituents significantly influences its chemical properties and reactivity. The fluorine and trifluoromethyl groups are electronegative, which can enhance the compound's stability and alter its electron density, making it a potential candidate for various chemical reactions, including electrophilic aromatic substitution. The nitro group is a strong electron-withdrawing group, which can further affect the compound's reactivity and polarity. This compound is typically used in organic synthesis and may have applications in pharmaceuticals or agrochemicals. Due to the presence of multiple fluorine atoms, it may exhibit unique physical properties, such as increased lipophilicity and altered boiling and melting points compared to non-fluorinated analogs. Safety and handling precautions are essential, as many fluorinated compounds can be toxic or environmentally persistent.
Formula:C7H3F4NO2
InChI:InChI=1S/C7H3F4NO2/c8-6-4(7(9,10)11)2-1-3-5(6)12(13)14/h1-3H
InChI key:PGKWPKDZNHZBQK-UHFFFAOYSA-N
SMILES:C1=CC(=C(C(=C1)[N+](=O)[O-])F)C(F)(F)F
Synonyms:
  • 2-Fluoro-3-Nitrobenzotrifluoride
Found 4 products.