CymitQuimica logo

CAS 61367-07-5

:

methyl 4-aminocyclohexanecarboxylate

Description:
Methyl 4-aminocyclohexanecarboxylate, identified by its CAS number 61367-07-5, is an organic compound characterized by its cyclohexane ring structure substituted with an amino group and a carboxylate ester. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents and exhibits moderate polarity due to the presence of both the amino and ester functional groups. The amino group can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Methyl 4-aminocyclohexanecarboxylate is of interest in various fields, including medicinal chemistry, where it may serve as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Its properties, such as boiling point, melting point, and specific reactivity, can vary based on the molecular environment and substituents. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H16ClNO2
InChI:InChI=1S/C8H15NO2.ClH/c1-11-8(10)6-2-4-7(9)5-3-6;/h6-7H,2-5,9H2,1H3;1H
InChI key:NHAYDXCUCXRAMF-UHFFFAOYSA-N
SMILES:COC(=O)C1CCC(CC1)N.Cl
Synonyms:
  • Methyl Trans-4-Aminocyclohexanecarboxylate Hydrochloride
  • trans-4-Amino-cyclohexanecarboxylic acid methyl ester hydrochloride
Found 6 products.