
CAS 613670-77-2
:Faropenem Impurity
Description:
Faropenem Impurity, identified by the CAS number 613670-77-2, is a chemical compound associated with the antibiotic faropenem, which belongs to the class of beta-lactam antibiotics. This impurity typically arises during the synthesis or degradation of faropenem and may exhibit similar structural features to the parent compound. Characteristics of Faropenem Impurity may include its molecular structure, which likely retains the beta-lactam ring, a key feature responsible for the antibiotic activity of related compounds. The impurity may also possess distinct physical and chemical properties, such as solubility, stability, and reactivity, which can differ from those of faropenem itself. Understanding the characteristics of such impurities is crucial for pharmaceutical quality control, as they can impact the efficacy and safety of the final drug product. Analytical techniques like HPLC, mass spectrometry, and NMR spectroscopy are often employed to identify and quantify impurities in pharmaceutical formulations.
Formula:C8H9NO3S
InChI:InChI=1S/C8H9NO3S/c10-8(11)6-7(13-4-9-6)5-2-1-3-12-5/h4-5H,1-3H2,(H,10,11)/t5-/m1/s1
InChI key:XZUWAHCIQCKWFP-RXMQYKEDSA-N
SMILES:C1C[C@@H](OC1)C2=C(N=CS2)C(=O)O
Synonyms:- 4-Thiazolecarboxylic acid, 5-[(2R)-tetrahydro-2-furanyl]-
- Faropenem Impurity 1 Q: What is the CAS Number of
- Faropenem Impurity 1Q: What is
- Faropenem Impurity 1
- (R)-5-(Tetrahydrofuran-2-yl)thiazole-4-carboxylic Acid
- Faropenem Impurity A
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
