CAS 6138-23-4: Trehalose, dihydrate
Description:Trehalose dihydrate is a disaccharide composed of two glucose molecules linked by an α,α-1,1-glycosidic bond. It is characterized by its ability to stabilize proteins and cellular structures, making it valuable in various biotechnological and pharmaceutical applications. Trehalose is known for its low hygroscopicity and high solubility in water, which contributes to its effectiveness as a cryoprotectant and stabilizer in freeze-drying processes. The dihydrate form indicates that it contains two molecules of water for each molecule of trehalose, influencing its physical properties, such as melting point and solubility. Trehalose is non-reducing, which distinguishes it from other sugars, and it has a relatively low caloric value, making it a subject of interest in food science and nutrition. Additionally, it exhibits antioxidant properties and has been studied for its potential health benefits, including neuroprotective effects. Overall, trehalose dihydrate is a versatile compound with significant applications in various fields, including food technology, pharmaceuticals, and biotechnology.
Formula:C12H22O11·2H2O
InChI:InChI=1S/C12H22O11.2H2O/c13-1-3-5(15)7(17)9(19)11(21-3)23-12-10(20)8(18)6(16)4(2-14)22-12;;/h3-20H,1-2H2;2*1H2/t3-,4-,5-,6-,7+,8+,9-,10-,11-,12-;;/m1../s1
InChI key:InChIKey=DPVHGFAJLZWDOC-PVXXTIHASA-N
SMILES:O.OCC1OC(OC2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O
- Synonyms:
- <span class="text-smallcaps">D</span>-(+)-Trehalose dihydrate
- D(+)trehalose dihydrate cell*culture tested
- D(+)trehalose reduced metal ion content dihydrate
- L-Trehalose Dihydrate
- Trehalose, dihydrate
- alpha,alpha-D-Trehalose dihydrate
- alpha-D-Glucopyranosyl-alpha-D-glucopyranoside dihydrate
- α,α-Trehalose dihydrate
- α-<span class="text-smallcaps">D</smallcap>-Glucopyranoside, α-<smallcap>D</span>-glucopyranosyl, dihydrate
- α-<span class="text-smallcaps">D</smallcap>-Glucopyranoside, α-<smallcap>D</span>-glucopyranosyl, hydrate (1:2)
- See more synonyms
- α-<span class="text-smallcaps">D</smallcap>-Glucopyranosyl α-<smallcap>D</span>-glucopyranoside dihydrate
- α-D-Glucopyranoside, α-D-glucopyranosyl, dihydrate
- D-Trehalose, dihydrate
- α-D-Glucopyranosyl α-D-glucopyranoside dihydrate
- D-(+)-Trehalose dihydrate
- α-D-Glucopyranoside, α-D-glucopyranosyl, hydrate (1:2)
- D(+)-Trehalose Dihydrate
- D(+)trehalose dihydrate
