CAS 6138-79-0: Triprolidine hydrochloride monohydrate
Description:Triprolidine hydrochloride monohydrate is an antihistamine used primarily for the relief of allergy symptoms, such as runny nose, sneezing, and itching. It is classified as a first-generation antihistamine, which means it can cross the blood-brain barrier, potentially leading to sedative effects. The chemical structure of triprolidine includes a piperidine ring, contributing to its pharmacological properties. As a hydrochloride salt, it is typically more soluble in water than its free base form, enhancing its bioavailability. The monohydrate form indicates the presence of one molecule of water associated with each molecule of the compound, which can influence its stability and solubility. Triprolidine is known for its relatively long duration of action compared to other first-generation antihistamines, making it effective for prolonged symptom relief. However, it may also cause side effects such as drowsiness, dry mouth, and dizziness. As with any medication, it is essential to use triprolidine under medical supervision to manage potential interactions and contraindications effectively.
Formula:C19H22N2·ClH·H2O
InChI:InChI=1S/C19H22N2.ClH.H2O/c1-16-7-9-17(10-8-16)18(19-6-2-3-12-20-19)11-15-21-13-4-5-14-21;;/h2-3,6-12H,4-5,13-15H2,1H3;1H;1H2/b18-11+;;
InChI key:InChIKey=CUZMOIXUFHOLLN-UMVVUDSKSA-N
SMILES:Cl.O.N=1C=CC=CC1C(=CCN2CCCC2)C3=CC=C(C=C3)C
- Synonyms:
- 1-[(2E)-3-(4-methylphenyl)-3-pyridin-2-ylprop-2-en-1-yl]pyrrolidinium chloride hydrate
- Pyridine, 2-[(1E)-1-(4-methylphenyl)-3-(1-pyrrolidinyl)-1-propen-1-yl]-, hydrochloride, hydrate (1:1:1)
- Pyridine, 2-[(1E)-1-(4-methylphenyl)-3-(1-pyrrolidinyl)-1-propenyl]-, monohydrochloride, monohydrate
- Pyridine, 2-[1-(4-methylphenyl)-3-(1-pyrrolidinyl)-1-propenyl]-, monohydrochloride, monohydrate, (E)-
- Pyridine, 2-[3-(1-pyrrolidinyl)-1-p-tolylpropenyl]-, monohydrochloride, monohydrate, stereoisomer
- Triprolidine hydrochloride monohydrate
