CAS 61381-36-0
:2-(4-oxoquinazolin-3(4H)-yl)propanoic acid
Description:
2-(4-oxoquinazolin-3(4H)-yl)propanoic acid, with the CAS number 61381-36-0, is a chemical compound that features a quinazoline core, which is a bicyclic structure known for its diverse biological activities. This compound is characterized by the presence of a propanoic acid moiety, contributing to its acidic properties. The quinazoline ring system typically exhibits a range of pharmacological effects, including anti-inflammatory and antimicrobial activities. The presence of the 4-oxo group enhances its reactivity and potential interactions with biological targets. In terms of solubility, compounds of this nature may exhibit moderate solubility in polar solvents due to the carboxylic acid functional group. Additionally, the compound's structure suggests potential for hydrogen bonding, which can influence its behavior in biological systems. Overall, 2-(4-oxoquinazolin-3(4H)-yl)propanoic acid represents a class of compounds that may be of interest in medicinal chemistry and drug development due to their unique structural features and potential therapeutic applications.
Formula:C11H10N2O3
InChI:InChI=1/C11H10N2O3/c1-7(11(15)16)13-6-12-9-5-3-2-4-8(9)10(13)14/h2-7H,1H3,(H,15,16)
SMILES:CC(C(=O)O)n1cnc2ccccc2c1=O
Synonyms:- 3(4H)-Quinazolineacetic acid, alpha-methyl-4-oxo-
- 2-(4-Oxoquinazolin-3(4H)-yl)propanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
