CAS 614-65-3
:6-[(2-phenylhydrazino)methylidene]cyclohexa-2,4-dien-1-one
Description:
6-[(2-phenylhydrazino)methylidene]cyclohexa-2,4-dien-1-one, with the CAS number 614-65-3, is an organic compound characterized by its unique structure, which features a cyclohexadienone core substituted with a phenylhydrazine moiety. This compound typically exhibits properties associated with both hydrazones and conjugated systems, such as potential reactivity in nucleophilic addition and electrophilic substitution reactions. The presence of the phenylhydrazine group may impart specific biological activities, making it of interest in medicinal chemistry. Additionally, the compound may display distinct optical properties due to its conjugated double bond system, which can influence its color and absorption characteristics. Its stability and reactivity can be affected by environmental factors such as pH and temperature. Overall, this compound serves as a valuable building block in organic synthesis and may have applications in various fields, including pharmaceuticals and materials science.
Formula:C13H12N2O
InChI:InChI=1/C13H12N2O/c16-13-9-5-4-6-11(13)10-14-15-12-7-2-1-3-8-12/h1-10,14-15H
SMILES:c1ccc(cc1)NNC=C1C=CC=CC1=O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Hydroxybenzaldehyde Phenylhydrazone
CAS:Formula:C13H12N2OPurity:>98.0%(GC)Color and Shape:White to Light yellow to Green powder to crystalMolecular weight:212.252-Hydroxybenzaldehyde Phenylhydrazone
CAS:Formula:C13H12N2OPurity:98%Color and Shape:SolidMolecular weight:212.24722-((2-Phenylhydrazono)Methyl)Phenol
CAS:2-((2-Phenylhydrazono)Methyl)PhenolFormula:C13H12N2OPurity:98%Color and Shape:SolidMolecular weight:212.252-((2-Phenylhydrazono)methyl)phenol
CAS:2-((2-Phenylhydrazono)methyl)phenolFormula:C13H12N2OPurity:98%Molecular weight:212.252-Hydroxybenzaldehyde phenylhydrazone
CAS:Formula:C13H12N2OPurity:98%Color and Shape:Liquid, No data available.Molecular weight:212.252Salicylaldehyde phenylhydrazone
CAS:Salicylaldehyde phenylhydrazone is a covid-19 pandemic, organometallic compound. It is a colorless solid that reacts with water to give hydrogen chloride and salicylaldehyde. Salicylaldehyde phenylhydrazone has been shown to react with amines, which may be due to its chelate ring system. The analytical method for this compound is gravimetric analysis, which involves the use of lanthanum as an indicator. This compound has good transport properties and can be activated by hydrogen gas.
Formula:C13H12N2OPurity:Min. 97 Area-%Color and Shape:PowderMolecular weight:212.25 g/mol





