CAS 61535-24-8

2-amino-3-(benzyloxy)benzoic acid

Description:

2-Amino-3-(benzyloxy)benzoic acid, with the CAS number 61535-24-8, is an organic compound characterized by its aromatic structure and functional groups. It features an amino group (-NH2) and a carboxylic acid group (-COOH) attached to a benzene ring, which contributes to its acidic properties. The presence of a benzyloxy group (-O-Ph) enhances its solubility in organic solvents and may influence its reactivity and biological activity. This compound is typically a white to off-white solid and is soluble in polar solvents like water and alcohols, depending on pH. Its molecular structure allows for potential applications in pharmaceuticals, particularly as a building block in drug synthesis or as a biochemical probe. Additionally, the compound may exhibit various biological activities, including anti-inflammatory or antimicrobial properties, making it of interest in medicinal chemistry. Proper handling and storage are essential due to its chemical nature, and safety data sheets should be consulted for specific handling guidelines.

Formula: C₁₄H₁₃NO₃

InChI: InChI=1/C14H13NO3/c15-13-11(14(16)17)7-4-8-12(13)18-9-10-5-2-1-3-6-10/h1-8H,9,15H2,(H,16,17)

SMILES: c1ccc(cc1)COc1cccc(c1N)C(=O)O

2-Amino-3-benzyloxybenzoic Acid

Controlled Product

CAS: 61535-24-8

Applications 2-Amino-3-benzyloxybenzoic Acid is an intermediate for substituted hydroxyacridone anticancer agents.
References Long-Su, T., et al.: PCT Int. Appl. 72 pp. (1992)

Formula: C₁₄H₁₃NO₃

Color and Shape: Neat

Molecular weight: 243.258

Ref: TR-A432120