CymitQuimica logo

CAS 61546-01-8

:

1-Hexadecyl-3-methylimidazolium chloride

Description:
1-Hexadecyl-3-methylimidazolium chloride is an ionic liquid characterized by its long hydrophobic alkyl chain and a positively charged imidazolium cation. This compound features a hexadecyl group, which contributes to its amphiphilic nature, allowing it to interact with both polar and nonpolar substances. The imidazolium ring provides stability and contributes to the ionic liquid's unique properties, such as low volatility and high thermal stability. As a chloride salt, it exhibits good solubility in polar solvents and can act as a solvent or catalyst in various chemical reactions. Its properties make it suitable for applications in electrochemistry, extraction processes, and as a medium for organic synthesis. Additionally, the presence of the long alkyl chain enhances its surface activity, making it useful in formulations for surfactants and emulsifiers. Overall, 1-Hexadecyl-3-methylimidazolium chloride is a versatile compound with significant potential in both industrial and research applications.
Formula:C20H39ClN2
InChI:InChI=1S/C20H39N2.ClH/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22-19-18-21(2)20-22;/h18-20H,3-17H2,1-2H3;1H/q+1;/p-1
InChI key:ZCPPLZJPPBIWRU-UHFFFAOYSA-M
SMILES:CCCCCCCCCCCCCCCCN1C=C[N+](=C1)C.[Cl-]
Found 5 products.