CAS 616-76-2
:5-Formylsalicylic acid
Description:
5-Formylsalicylic acid, with the CAS number 616-76-2, is an organic compound that features both an aldehyde and a carboxylic acid functional group, making it a derivative of salicylic acid. This compound is characterized by its aromatic ring, which contributes to its stability and reactivity. The presence of the formyl group (-CHO) at the 5-position of the salicylic acid structure enhances its potential for various chemical reactions, including condensation and oxidation. 5-Formylsalicylic acid is typically a white to off-white crystalline solid, soluble in polar solvents such as water and alcohols, which facilitates its use in various chemical syntheses and applications. It may exhibit biological activity, making it of interest in pharmaceutical research. Additionally, its structural features allow it to participate in hydrogen bonding, influencing its physical properties and interactions with other molecules. Overall, 5-Formylsalicylic acid serves as a valuable compound in organic chemistry and medicinal chemistry contexts.
Formula:C8H6O4
InChI:InChI=1S/C8H6O4/c9-4-5-1-2-7(10)6(3-5)8(11)12/h1-4,10H,(H,11,12)
InChI key:InChIKey=UTCFOFWMEPQCSR-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(C=O)=CC=C1O
Synonyms:- 2-Hydroxy-5-formylbenzoic acid
- 3-Carboxy-4-hydroxybenzaldehyde
- 3-Formyl-6-hydroxybenzoic acid
- 5-Formyl-2-Hydroxybenzoate
- 5-Formyl-2-Hydroxybenzoic Acid
- 6-Hydroxyisophthalaldehydic acid
- Benzoic acid, 5-formyl-2-hydroxy-
- Formylsalicylicacid
- Isophthalaldehydic acid, 6-hydroxy-
- NSC 15046
- NSC 16527
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
5-Formylsalicylic Acid
CAS:Formula:C8H6O4Purity:>98.0%(T)(HPLC)Color and Shape:White to Yellow powder to crystalMolecular weight:166.135-Formylsalicylic acid
CAS:5-Formyl-2-hydroxybenzoic acidFormula:C8H6O4Purity:98% HPLCMolecular weight:166.135-Formyl-2-hydroxybenzoic acid
CAS:Formula:C8H6O4Purity:97%Color and Shape:SolidMolecular weight:166.13085-Formylsalicylic Acid
CAS:5-Formylsalicylic AcidFormula:C8H6O4Purity:98%Color and Shape:Pale yellow SolidMolecular weight:166.130835-Formylsalicylic acid
CAS:5-Formylsalicylic acid is a molecule that has the chemical formula HOOC-(CH2)4-COOH. It is an organic acid that is derived from 5-nitrosalicylic acid, which is prepared by reacting sodium carbonate with hydroxybenzoic acid in the presence of ethylene diamine. This compound has been shown to have the ability to form hydrogen bonds with other molecules and itself. 5-Formylsalicylic acid can be synthesized by reacting sodium hydroxide with hydrogen chloride gas in a neutral pH environment. The surface methodology for this compound was determined to be gravimetric analysis, while it exhibits intermolecular hydrogen bonding interactions and matrix effects. Hydrogen bonding interactions are formed through nitrogen atoms and carboxylate groups on the surface of the molecule.Formula:C8H6O4Purity:Min. 95%Color and Shape:PowderMolecular weight:166.13 g/mol5-Formylsalicylic Acid
CAS:Controlled ProductFormula:C8H6O4Color and Shape:NeatMolecular weight:166.131






