CAS 6165-68-0
:2-Thienylboronic acid
Description:
2-Thienylboronic acid, with the CAS number 6165-68-0, is an organoboron compound characterized by the presence of a boronic acid functional group attached to a thiophene ring. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the boronic acid moiety. The thiophene ring contributes to its aromatic properties, enhancing its stability and reactivity. 2-Thienylboronic acid is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and materials science. It serves as a valuable building block in the development of pharmaceuticals and agrochemicals, as well as in the preparation of sensors and catalysts. Additionally, its unique electronic properties allow for potential applications in organic electronics and optoelectronics. Handling this compound requires standard laboratory safety precautions, as with other boronic acids, due to its potential reactivity and the need for proper disposal methods.
Formula:C4H5BO2S
InChI:InChI=1S/C4H5BO2S/c6-5(7)4-2-1-3-8-4/h1-3,6-7H
InChI key:InChIKey=ARYHTUPFQTUBBG-UHFFFAOYSA-N
SMILES:B(O)(O)C1=CC=CS1
Synonyms:- 2-Thienylboric acid
- 2-Thienylboronic acid
- 2-Thiophene Boric Acid
- 2-Thiophene Boronic Acid
- 2-Thiopheneboric acid
- 2-Thiopheneboronic acid
- B-2-Thienylboronic acid
- Boronic acid, 2-thienyl-
- Boronic acid, B-2-thienyl-
- Thien-5-ylboronic acid
- Thiophen-2-Ylboronic Acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
2-Thiopheneboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C4H5BO2SColor and Shape:White to Orange to Green powder to crystalMolecular weight:127.95Thiophene-2-boronic acid, 97%
CAS:Thiophene-2-boronic acid is a reagent used for Palladium-catalyzed Suzuki-Miyaura cross-couplings, Copper-catalyzed nitration reactions, Chain-growth catalyst transfer polycondensation of conjugated alternating copolymer, Ferric perchlorate-promoted reaction of fullerene to give fullerenyl boronic eFormula:C4H5BO2SPurity:97%Color and Shape:White to cream, PowderMolecular weight:127.952-Thiopheneboronic acid, min. 97%
CAS:2-Thiopheneboronic acid, min. 97%
Formula:C4H3SB(OH)2Purity:min. 97%Color and Shape:white to off-white pwdr.Molecular weight:127.96Thiophene-2-boronic acid
CAS:Formula:C4H5BO2SPurity:98%Color and Shape:SolidMolecular weight:127.9573Ref: IN-DA0035P1
1kgTo inquire1g20.00€5g23.00€10g28.00€25g52.00€50g64.00€100g116.00€250g163.00€25kg15,828.00€Thiophene-2-boronic acid
CAS:Thiophene-2-boronic acidFormula:C4H5BO2SPurity:98%Color and Shape:SolidMolecular weight:127.9573Thiophene-2-boronic acid
CAS:Formula:C4H5BO2SPurity:98.0%Color and Shape:Solid, Chunks or Crystalline PowderMolecular weight:127.95Thiophen-2-ylboronic acid
CAS:Thiophen-2-ylboronic acidFormula:C4H5BO2SPurity:98%Molecular weight:127.96Thiophene-2-Boronic Acid extrapure, 98%
CAS:Formula:C4H5BO2SPurity:min. 98%Color and Shape:White to off - white, PowderMolecular weight:127.962-Thiopheneboronic acid (contains varying amounts of anhydride)
CAS:2-Thiopheneboronic acid is a heterocyclic compound that forms insoluble polymers when reacted with anhydride. It has been shown to be effective in the treatment of diabetes patients, as it improves glucose metabolism and insulin sensitivity. 2-Thiopheneboronic acid is also used in the palladium-catalyzed coupling reaction, which is used to form carbon-carbon bonds between two alkenes. The reaction mechanism for this reaction involves three steps: oxidative addition, transmetalation, and reductive elimination. 2-Thiopheneboronic acid can also be used in Suzuki coupling reactions, which are catalyzed by palladium complexes. This type of reaction is used to create carbon-carbon bonds between two alkenes or one alkene and one alkyne. This process requires three steps: oxidative addition, transmetalation, and reductive elimination. 2-Thiopheneboronic acid may inhibit bacterial enzymes such as nitroreductase andFormula:C4H5BO2SPurity:Min. 95%Molecular weight:127.96 g/mol









