CymitQuimica logo

CAS 61698-76-8

:

2-[4-(2,3-dihydroxypropoxy)phenyl]acetamide

Description:
2-[4-(2,3-dihydroxypropoxy)phenyl]acetamide, with the CAS number 61698-76-8, is an organic compound characterized by its amide functional group and a phenyl ring substituted with a dihydroxypropoxy group. This compound typically exhibits properties associated with both hydrophilicity and lipophilicity due to the presence of hydroxyl groups and an aromatic structure, which can influence its solubility in various solvents. The dihydroxypropoxy moiety may enhance its potential for hydrogen bonding, affecting its reactivity and interaction with biological systems. As an amide, it may also participate in various chemical reactions, including hydrolysis and amidation. The compound's structure suggests potential applications in pharmaceuticals or as a biochemical probe, although specific biological activities would depend on further empirical studies. Overall, its unique structural features contribute to its chemical behavior and potential utility in various fields, including medicinal chemistry and materials science.
Formula:C11H15NO4
InChI:InChI=1/C11H15NO4/c12-11(15)5-8-1-3-10(4-2-8)16-7-9(14)6-13/h1-4,9,13-14H,5-7H2,(H2,12,15)
InChI key:CQOQCZLTCMUVMX-UHFFFAOYSA-N
SMILES:c1cc(ccc1CC(=N)O)OCC(CO)O
Found 9 products.