
CAS 61704-38-9
:6-(3-Chlorophenyl)-2-pyridinecarboxaldehyde
Description:
6-(3-Chlorophenyl)-2-pyridinecarboxaldehyde, with the CAS number 61704-38-9, is an organic compound characterized by its pyridine and aldehyde functional groups. This compound features a pyridine ring substituted at the 2-position with a carboxaldehyde group and at the 6-position with a 3-chlorophenyl group. The presence of the chlorophenyl moiety contributes to its potential reactivity and biological activity, as halogenated aromatic compounds often exhibit unique properties. The aldehyde functional group is known for its reactivity, particularly in condensation reactions and as a precursor in various synthetic pathways. This compound may be utilized in organic synthesis, medicinal chemistry, or as an intermediate in the production of more complex molecules. Its physical properties, such as solubility and melting point, would depend on the specific conditions and purity of the sample. Overall, 6-(3-Chlorophenyl)-2-pyridinecarboxaldehyde is of interest in both academic and industrial chemistry due to its structural features and potential applications.
Formula:C12H8ClNO
InChI:InChI=1S/C12H8ClNO/c13-10-4-1-3-9(7-10)12-6-2-5-11(8-15)14-12/h1-8H
InChI key:InChIKey=LDXZAMHCPAKKDE-UHFFFAOYSA-N
SMILES:C(=O)C1=NC(=CC=C1)C2=CC(Cl)=CC=C2
Synonyms:- 6-(3-Chlorophenyl)-2-pyridinecarboxaldehyde
- 2-Pyridinecarboxaldehyde, 6-(3-chlorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
