CAS 6174-86-3
:Chlorferon
Description:
Chlorferon, with the CAS number 6174-86-3, is a synthetic compound that belongs to the class of chlorinated aromatic compounds. It is primarily known for its use as an immunomodulator, exhibiting properties that can enhance the immune response. Chlorferon is characterized by its ability to stimulate the production of interferons, which are proteins that play a crucial role in the body's defense against viral infections and certain types of cancer. The compound is typically administered in a pharmaceutical context, and its efficacy and safety profile have been studied in various clinical settings. In terms of physical properties, Chlorferon is generally a solid at room temperature, with specific solubility characteristics that may vary depending on the solvent used. As with many chemical substances, handling Chlorferon requires adherence to safety protocols due to its potential biological activity and the need for proper storage conditions to maintain its stability. Overall, Chlorferon represents a significant interest in both medicinal chemistry and therapeutic applications.
Formula:C10H7ClO3
InChI:InChI=1S/C10H7ClO3/c1-5-7-3-2-6(12)4-8(7)14-10(13)9(5)11/h2-4,12H,1H3
InChI key:InChIKey=ODZHLDRQCZXQFQ-UHFFFAOYSA-N
SMILES:CC=1C=2C(OC(=O)C1Cl)=CC(O)=CC2
Synonyms:- 2H-1-Benzopyran-2-one, 3-chloro-7-hydroxy-4-methyl-
- 3-Chloro-4-methylumbelliferone
- 3-Chloro-7-hydroxy-4-methyl-2H-1-benzopyran-2-one
- 3-Chloro-7-hydroxy-4-methylchromen-2-one
- 3-Chloro-7-hydroxy-4-methylcoumarin
- 3-chloro-7-hydroxy-4-methyl-2H-chromen-2-one
- 7-Hydroxy-4-methyl-3-chlorocoumarin
- Chlorferon
- Chlorferone
- Coumarin, 3-chloro-7-hydroxy-4-methyl-
- NSC 24924
- NSC 44204
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
3-Chloro-7-hydroxy-4-methylcoumarin
CAS:Formula:C10H7ClO3Purity:>98.0%(T)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:210.613-Chloro-7-hydroxy-4-methyl-2H-chromen-2-one
CAS:3-Chloro-7-hydroxy-4-methyl-2H-chromen-2-oneFormula:C10H7ClO3Purity:95%Molecular weight:210.613-Chloro-7-hydroxy-4-methyl-2H-chromen-2-one
CAS:Formula:C10H7ClO3Purity:95%Color and Shape:SolidMolecular weight:210.61383-Chloro-7-hydroxy-4-methylcoumarin
CAS:3-Chloro-7-hydroxy-4-methylcoumarinFormula:C10H7ClO3Purity:98%Color and Shape:SolidMolecular weight:210.61378Coumaphos alcohol metabolite
CAS:Controlled ProductFormula:C10H7ClO3Color and Shape:NeatMolecular weight:210.613-Chloro-7-hydroxy-4-methylcoumarin
CAS:3-Chloro-7-hydroxy-4-methylcoumarin is a Michaelis–Menten kinetics inhibitor that binds to the bacterial 16S ribosomal RNA and inhibits transcription and protein synthesis. This compound has been studied for wastewater treatment, where it was shown to be effective in treating sodium citrate. 3-Chloro-7-hydroxy-4-methylcoumarin is also used as an inhibitor of coumarin derivatives, which are compounds that have been shown to have antiinflammatory properties. 3CMC inhibits transcription by binding to the polymerase chain reaction (PCR) product. It has also been shown to bind to the nonpolar solvent, which prevents the formation of a complex with the enzyme DNA gyrase, leading to cell death by inhibiting protein synthesis. Fluorescence techniques have been used to study this type of inhibition in a model system.Formula:C10H7ClO3Purity:Min. 95%Color and Shape:PowderMolecular weight:210.61 g/mol3-Chloro-7-hydroxy-4-methyl-2H-chromen-2-one
CAS:Formula:C10H7ClO3Purity:98%Color and Shape:Liquid, No data available.Molecular weight:210.61Chlorferon-13C6
CAS:Controlled ProductApplications Labelled Chlorferon is has α-Glucosidase inhibitory antihyperglycemic activity of substituted chromenone derivatives. Also used in the synthesis of fluorogenic substrates for the detection of bacterial β-Galactosidase.
References Raju, B. et al.: Bioorg. Med. Chem., 18, 358 (2010); Chilvers, K. et al.: J. App. Microbiol., 91, 1118 (2001);Formula:C6C4H7ClO3Color and Shape:NeatMolecular weight:210.61








