CAS 619-05-6
:3,4-Diaminobenzoic acid
Description:
3,4-Diaminobenzoic acid, with the CAS number 619-05-6, is an aromatic amine and a derivative of benzoic acid. It features two amino groups (-NH2) located at the 3 and 4 positions of the benzene ring, making it a diaminobenzoic acid. This compound is typically a white to off-white crystalline solid that is soluble in water and polar organic solvents. It exhibits basic properties due to the presence of amino groups, which can participate in hydrogen bonding and protonation reactions. 3,4-Diaminobenzoic acid is known for its role in the synthesis of various dyes, pharmaceuticals, and as a building block in organic synthesis. Additionally, it has applications in the field of biochemistry, particularly in the study of amino acid interactions and as a potential precursor for the production of polymers. Its chemical structure allows it to engage in various reactions, including acylation and coupling reactions, making it a versatile compound in chemical research and industrial applications.
Formula:C7H8N2O2
InChI:InChI=1S/C7H8N2O2/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3H,8-9H2,(H,10,11)
InChI key:InChIKey=HEMGYNNCNNODNX-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(N)=C(N)C=C1
Synonyms:- 3,4-Diaminobenzoate
- 4-Carboxy-1,2-benzenediamine
- 4-Carboxy-1,2-diaminobenzene
- 4-Carboxy-o-phenylenediamine
- 4-Carboxyphenyldiamine
- Benzoic acid, 3,4-diamino-
- 3,4-Diaminobenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
3,4-Diaminobenzoic Acid
CAS:Formula:C7H8N2O2Purity:min. 98.0 area%(HPLC)Color and Shape:Light yellow to Brown powder to crystalMolecular weight:152.153,4-Diaminobenzoic acid, 94%
CAS:3,4-Diaminobenzoic acid undergoes cyclocondensations to form, for example, quinoxalines1 and benzimidazoles. It acts as a redox label for electrochemical detection of single base mismatches. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. SomeFormula:C7H7N2O2Purity:94%Color and Shape:Powder, Pale brown to brownMolecular weight:151.15Ref: IN-DA003IFG
5g20.00€10g26.00€25g28.00€100g65.00€250g124.00€500g183.00€1kg264.00€5kg686.00€10kg963.00€25kg2,226.00€3,4-Diaminobenzoic acid
CAS:Formula:C7H8N2O2Color and Shape:Off-white to beige or brown powder to crystalsMolecular weight:152.153,4-Diaminobenzoic acid
CAS:3,4-Diaminobenzoic acidFormula:C7H8N2O2Purity:97%Color and Shape:Solid-PowderMolecular weight:152.150623,4-Diaminobenzoic acid
CAS:3,4-Diaminobenzoic acid is a compound that is produced by the condensation of two molecules of hydrochloric acid. 3,4-Diaminobenzoic acid has been used as a reagent in the synthesis of coumarin derivatives. This chemical has been shown to be an effective proton scavenger in an optimum concentration. Benzimidazole compounds are also synthesized from 3,4-diaminobenzoic acid and have been shown to be effective against autoimmune diseases. 3,4-Diaminobenzoic acid can be used for the production of diazonium salts, which are used in the synthesis of anti-inflammatory drugs and other pharmaceuticals. The hydroxyl group on this molecule makes it chemically stable and kinetic data shows that it has high diphenolase activity.Formula:C7H8N2O2Purity:Min. 96 Area-%Color and Shape:PowderMolecular weight:152.15 g/mol3,4-Diaminobenzoic acid
CAS:Formula:C7H8N2O2Purity:97%Color and Shape:Solid, Crystalline Powder or PowderMolecular weight:152.153







