CAS 619-19-2
:2-Hydroxy-4-nitrobenzoic acid
Description:
2-Hydroxy-4-nitrobenzoic acid, also known as salicylic acid 4-nitro derivative, is an organic compound with the molecular formula C7H6N2O4. It features a benzoic acid structure with a hydroxyl group (-OH) and a nitro group (-NO2) positioned at the 2 and 4 positions, respectively. This compound is typically a white to pale yellow crystalline solid that is soluble in water and organic solvents, reflecting its polar functional groups. It exhibits acidic properties due to the carboxylic acid group, making it capable of donating protons in solution. The presence of the nitro group contributes to its reactivity and potential applications in organic synthesis and pharmaceuticals. Additionally, 2-Hydroxy-4-nitrobenzoic acid can serve as an intermediate in the synthesis of various dyes and agrochemicals. Its chemical behavior is influenced by the electron-withdrawing nature of the nitro group, which can affect the acidity and reactivity of the compound in various chemical reactions. Safety precautions should be taken when handling this substance, as it may pose health risks upon exposure.
Formula:C7H5NO5
InChI:InChI=1S/C7H5NO5/c9-6-3-4(8(12)13)1-2-5(6)7(10)11/h1-3,9H,(H,10,11)
InChI key:InChIKey=UKWUOTZGXIZAJC-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=CC(O)=C(C(O)=O)C=C1
Synonyms:- 2-Hydroxy-4-nitrobenzoic acid
- 4-Nitro-2-hydroxybenzoic acid
- Benzoic acid, 2-hydroxy-4-nitro-
- NSC 882
- Salicylic acid, 4-nitro-
- p-Nitrosalicylic acid
- 4-Nitrosalicylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
4-Nitrosalicylic Acid
CAS:Formula:C7H5NO5Purity:>98.0%(T)Color and Shape:White to Gray to Brown powder to crystalMolecular weight:183.122-Hydroxy-4-nitrobenzoic acid
CAS:2-Hydroxy-4-nitrobenzoic acidFormula:C7H5NO5Purity:96%Color and Shape:SolidMolecular weight:183.11832-Hydroxy-4-nitrobenzoic acid
CAS:2-Hydroxy-4-nitrobenzoic acid is a high quality and versatile building block for the synthesis of pharmaceuticals, agrochemicals, and other chemicals. It is used as a reagent in organic synthesis, as well as a stabilizer for dyes and pigments. The compound has been shown to be an intermediate in the reaction of 2-amino-4-nitrophenol with formaldehyde to produce 2-(2-hydroxyethoxy)ethanol. 2-Hydroxy-4-nitrobenzoic acid can also act as a scaffold molecule in the synthesis of other chemical compounds.Formula:C7H5NO5Molecular weight:183.12 g/mol2-Hydroxy-4-nitrobenzoic acid
CAS:Formula:C7H5NO5Purity:97%Color and Shape:SolidMolecular weight:183.1194-Nitrosalicylic Acid-d3
CAS:Controlled ProductFormula:C7D3H2NO5Color and Shape:NeatMolecular weight:186.137






