CAS 61903-11-5
:1-Acetylhomopiperazine
Description:
1-Acetylhomopiperazine is a chemical compound characterized by its piperazine ring structure, which is a six-membered saturated heterocycle containing two nitrogen atoms. The presence of an acetyl group at the 1-position of the homopiperazine structure contributes to its reactivity and potential applications in various chemical syntheses. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in polar organic solvents, which enhances its utility in organic synthesis and pharmaceutical applications. 1-Acetylhomopiperazine may exhibit biological activity, making it of interest in medicinal chemistry for the development of new therapeutic agents. As with many nitrogen-containing heterocycles, it may participate in hydrogen bonding and other intermolecular interactions, influencing its physical and chemical properties. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C7H14N2O
InChI:InChI=1/C7H14N2O/c1-7(10)9-5-2-3-8-4-6-9/h8H,2-6H2,1H3
SMILES:CC(=O)N1CCCNCC1
Synonyms:- 1-(1,4-Diazepan-1-yl)ethanone
- ethanone, 1-(hexahydro-1H-1,4-diazepin-1-yl)-
- 1-Acetyl-1,4-Diazepane
- N-Acetylhomopiperazine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-(1,4-Diazepan-1-yl)ethanone
CAS:1-(1,4-Diazepan-1-yl)ethanoneFormula:C7H14N2OPurity:97%Molecular weight:142.2021-(1,4-Diazepan-1-yl)ethanone
CAS:Formula:C7H14N2OPurity:97%Color and Shape:LiquidMolecular weight:142.19891-(1,4-Diazepan-1-yl)ethan-1-one
CAS:Formula:C7H14N2OPurity:>95.0%(GC)(T)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:142.201-(1,4-Diazepan-1-yl)ethanone
CAS:Formula:C7H14N2OPurity:98%Color and Shape:ClearMolecular weight:142.2021-(1,4-Diazepan-1-yl)ethanone
CAS:1-(1,4-Diazepan-1-yl)ethanone is an imidazopyridine that acts as a competitive inhibitor of tyrosine kinases, which are enzymes important for the transmission of signals in the central nervous system and other tissues. This drug has been shown to have a high degree of selectivity for receptor tyrosine kinases and inhibit the activity of IGF-1 receptor at low concentrations, with no significant effects on other receptors such as dopamine or serotonin. 1-(1,4-Diazepan-1-yl)ethanone has also been shown to be an effective inhibitor of channel proteins that mediate neurotransmitter release.Formula:C7H14N2OPurity:Min. 95%Molecular weight:142.2 g/mol




