CAS 6199-67-3
:(+)-Cucurbitacin B
Description:
(+)-Cucurbitacin B is a triterpenoid compound belonging to the cucurbitacin family, which is primarily derived from various plants in the Cucurbitaceae family, such as cucumbers and gourds. This compound is characterized by its complex tetracyclic structure, which contributes to its biological activity. It is known for its bitter taste and has been studied for its potential pharmacological properties, including anti-cancer, anti-inflammatory, and anti-diabetic effects. (+)-Cucurbitacin B exhibits cytotoxicity against various cancer cell lines, making it a subject of interest in cancer research. Additionally, it has been shown to influence several signaling pathways, including those related to apoptosis and cell proliferation. The compound is typically found in low concentrations in plant extracts and can be isolated through various extraction and purification techniques. Its unique structure and biological activities make it a valuable compound for further research in medicinal chemistry and pharmacology. However, due to its potent effects, caution is advised in its use and handling.
Formula:C32H46O8
InChI:InChI=1S/C32H46O8/c1-17(33)40-27(2,3)13-12-23(36)32(9,39)25-21(35)15-29(6)22-11-10-18-19(14-20(34)26(38)28(18,4)5)31(22,8)24(37)16-30(25,29)7/h10,12-13,19-22,25,34-35,39H,11,14-16H2,1-9H3/b13-12+/t19-,20+,21-,22+,25+,29+,30-,31+,32+/m1/s1
InChI key:InChIKey=IXQKXEUSCPEQRD-DKRGWESNSA-N
SMILES:C[C@]12[C@@](C)([C@@]([C@@](C(/C=C/C(OC(C)=O)(C)C)=O)(C)O)([C@H](O)C1)[H])CC(=O)[C@]3(C)[C@]2(CC=C4[C@]3(C[C@H](O)C(=O)C4(C)C)[H])[H]
Synonyms:- (23E)-2,16,20-trihydroxy-9,10,14-trimethyl-1,11,22-trioxo-4,9-cyclo-9,10-secocholesta-5,23-dien-25-yl acetate
- (2S,4R,9beta,16alpha)-2,16,20-trihydroxy-9,10,14-trimethyl-1,11,22-trioxo-4,9-cyclo-9,10-secocholesta-5,23-dien-25-yl acetate
- (2S,4R,9beta,16alpha,17xi,23E)-2,16,20-trihydroxy-9,10,14-trimethyl-1,11,22-trioxo-4,9-cyclo-9,10-secocholesta-5,23-dien-25-yl acetate
- (2S,4R,9beta,16alpha,23E)-2,16,20-trihydroxy-9,10,14-trimethyl-1,11,22-trioxo-4,9-cyclo-9,10-secocholesta-5,23-dien-25-yl acetate
- (2β,9β,10α,16α,23E)-25-(Acetyloxy)-2,16,20-trihydroxy-9-methyl-19-norlanosta-5,23-diene-3,11,22-trione
- 19-Nor-9β,10α-lanosta-5,23-diene-3,11,22-trione, 2β,16α,20,25-tetrahydroxy-9-methyl-, 25-acetate
- 19-Norlanosta-5,23-diene-3,11,22-trione, 25-(acetyloxy)-2,16,20-trihydroxy-9-methyl-, (2β,9β,10α,16α,23E)-
- Amarine
- Cucurbitacine B
- Hy-N 0416
- NSC 144154
- NSC 49451
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
Cucurbitacin B
CAS:Formula:C32H46O8Purity:>98.0%(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:558.71Cucurbitacin B
CAS:Cucurbitacin B analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C32H46O8Purity:(HPLC) ≥95%Color and Shape:PowderMolecular weight:558.72Cucurbitacin B
CAS:Cucurbitacin B (cucB) is a triterpenoid constituent of Cucurbitaceae vegetables and a promising phytochemical for cancer prevention, cucB induces G(2) arrest and apoptosis through a STAT3-independent but ROS-dependent mechanism in SW480 cells.Formula:C32H46O8Purity:95%~99%Color and Shape:White powderMolecular weight:558.712Cucurbitacin B
CAS:Cucurbitacin B (Cuc B) has profound in vitro and in vivo antiproliferative effects against human pancreatic Y cells.Formula:C32H46O8Purity:97.1% - 99.93%Color and Shape:SolidMolecular weight:558.70Cucurbitacin B
CAS:Formula:C32H46O8Purity:≥ 98.0%Color and Shape:White to off-white powderMolecular weight:558.71Cucurbitacin b
CAS:Carboxylic acid with additional oxygen functionsFormula:C32H46O8Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:558.71Cucurbitacin B
CAS:Controlled ProductCucurbitacin B is a triterpenoid compound, which is derived from plants primarily within the Cucurbitaceae family. This compound exhibits its mode of action through the inhibition of the JAK-STAT signaling pathway, effectively disrupting processes that are critical for cell survival and proliferation. As a result, Cucurbitacin B is being extensively studied for its antiproliferative and pro-apoptotic properties, especially in the context of cancer research.Formula:C32H46O8Purity:Min. 95%Color and Shape:White PowderMolecular weight:558.7 g/molCucurbitacin B
CAS:Controlled ProductApplications Cucurbitacin B is a tetracyclic triterpenoid, which can induce apoptosis in human hepatoma cells. It can also induce DNA damage and autophagy in MCF-7 breast cancer cells.In the wild, watermelons, cucumbers, and muskmelons produce bitter Cucurbitacins to defend against preditors. Humans have bred these fruits to eliminate these compounds thereby yielding fruits that are more appealing to our palate.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Sun, Y., et al.: Eur. J. Pharmacol. 768, 28 (2015); Ren, G., et al.: J. Nat. Med. 69, 522 (2015); C&E News p. 10, Dec. 5, 2016jFormula:C32H46O8Color and Shape:NeatMolecular weight:558.7









