CymitQuimica logo

CAS 62245-12-9

:

2(1H)-Quinolinone, 6-acetyl-3,4-dihydro-

Description:
2(1H)-Quinolinone, 6-acetyl-3,4-dihydro- is an organic compound characterized by its quinolinone structure, which features a fused bicyclic system containing a nitrogen atom. This compound typically exhibits a pale yellow to brownish appearance and is soluble in organic solvents such as ethanol and acetone, but may have limited solubility in water. The presence of the acetyl group contributes to its reactivity, making it a potential candidate for various chemical reactions, including acylation and condensation. It may also display biological activity, as many quinolinone derivatives are known for their pharmacological properties, including antimicrobial and anticancer effects. The compound's molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, its stability under standard laboratory conditions and its ability to undergo further chemical modifications enhance its utility in synthetic organic chemistry. As with many chemical substances, proper handling and safety precautions are essential due to potential toxicity or reactivity.
Formula:C11H11NO2
InChI:InChI=1S/C11H11NO2/c1-7(13)8-2-4-10-9(6-8)3-5-11(14)12-10/h2,4,6H,3,5H2,1H3,(H,12,14)
InChI key:FXPPYJRCOQZMIL-UHFFFAOYSA-N
SMILES:CC(=O)C1=CC2=C(C=C1)NC(=O)CC2
Found 4 products.