CymitQuimica logo

CAS 62281-06-5

:

1-Dodecanamine, 2-octyl-

Description:
1-Dodecanamine, 2-octyl- is an organic compound classified as an amine, specifically a long-chain primary amine. It features a dodecyl group (a 12-carbon alkyl chain) attached to a nitrogen atom, which is also bonded to an octyl group (an 8-carbon alkyl chain). This structure imparts both hydrophobic and hydrophilic characteristics, making it amphiphilic. The compound is typically a colorless to pale yellow liquid or solid at room temperature, depending on its purity and specific conditions. It is soluble in organic solvents but has limited solubility in water due to its long hydrocarbon chains. 1-Dodecanamine, 2-octyl- is often used in various applications, including surfactants, emulsifiers, and as a potential intermediate in the synthesis of other chemical compounds. Its properties can be influenced by factors such as temperature and the presence of other substances. Safety data should be consulted for handling and exposure guidelines, as amines can be irritants and may pose health risks.
Formula:C20H43N
InChI:InChI=1S/C20H43N/c1-3-5-7-9-11-12-14-16-18-20(19-21)17-15-13-10-8-6-4-2/h20H,3-19,21H2,1-2H3
InChI key:VDNQHHBRKZQBPY-UHFFFAOYSA-N
SMILES:CCCCCCCCCCC(CCCCCCCC)CN
Found 6 products.