CAS 623-81-4
:Diethyl sulfite
Description:
Diethyl sulfite is an organic compound with the chemical formula C4H10O3S. It is classified as a sulfite ester, characterized by the presence of a sulfur atom bonded to two ethyl groups and an oxygen atom. This colorless liquid has a distinctive odor reminiscent of sulfur and is soluble in organic solvents but only slightly soluble in water. Diethyl sulfite is primarily used as a solvent and as an intermediate in the synthesis of various organic compounds. It exhibits moderate volatility and can be flammable under certain conditions. The compound is known to have a low toxicity profile, but exposure can cause irritation to the eyes, skin, and respiratory system. In terms of reactivity, diethyl sulfite can undergo hydrolysis in the presence of water, leading to the formation of ethanol and sulfurous acid. Proper handling and storage are essential to minimize risks associated with its use, including ensuring adequate ventilation and using appropriate personal protective equipment.
Formula:C4H10O3S
InChI:InChI=1S/C4H10O3S/c1-3-6-8(5)7-4-2/h3-4H2,1-2H3
InChI key:InChIKey=NVJBFARDFTXOTO-UHFFFAOYSA-N
SMILES:S(OCC)(OCC)=O
Synonyms:- Brn 1701906
- Diethyl sulphite
- Ethyl sulfite
- Ethyl sulfite, (Et2SO3)
- Nsc 8838
- Sulfurous acid, diethyl ester
- Tl 158
- 4-01-00-01324 (Beilstein Handbook Reference)
- Diethyl sulfite
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Diethyl Sulfite
CAS:Formula:C4H10O3SPurity:>98.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:138.18Diethyl sulfite
CAS:Diethyl sulfite is a chemical compound that is used as an analytical reagent in organic chemistry. It reacts with hydrochloric acid to produce sulfur dioxide gas and water vapor, which are both colorless. The frequency of the hydrogen bond between diethyl sulfite and hydrochloric acid can be determined by using electrochemical impedance spectroscopy. The thermal expansion of diethyl sulfite is greater than that of water at temperatures above 100°C. Diethyl sulfite is also soluble in lithium and reacts with hydrogen fluoride to produce lithium sulfate and hydrogen gas. This reaction mechanism has been shown to be reversible when solid catalysts such as palladium, nickel, or platinum are used.
Formula:C4H10O3SPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:138.18 g/molDiethyl sulfite
CAS:Formula:C4H10O3SPurity:99%Color and Shape:No data available.Molecular weight:138.18





