CAS 623172-56-5
:N2-(1-Oxohexadecyl)-L-lysyl-L-valyl-L-lysine 2,2,2-trifluoroacetate (1:2)
Description:
N2-(1-Oxohexadecyl)-L-lysyl-L-valyl-L-lysine 2,2,2-trifluoroacetate (1:2) is a synthetic compound characterized by its complex structure, which includes a long-chain fatty acid derivative and multiple amino acid residues. The presence of the hexadecyl group suggests that it has hydrophobic properties, which may influence its solubility and interaction with biological membranes. The amino acids L-lysine and L-valine contribute to its potential biological activity, as they are essential for various physiological processes. The trifluoroacetate moiety indicates that the compound may exhibit unique chemical reactivity and stability, particularly in aqueous environments. This compound is likely to be of interest in fields such as medicinal chemistry and biochemistry, where it may serve as a model for studying peptide interactions or as a potential therapeutic agent. Its specific applications would depend on its biological activity, stability, and interaction with other biomolecules. As with any chemical substance, safety and handling precautions should be observed due to its synthetic nature and potential biological effects.
Formula:C33H65N5O5.2(C2HF3O2)
Synonyms:- Pal-Kvk
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Syn-Coll, Palmitoyl Tripeptide-5
CAS:Formula:C33H65N5O5·2(C2HF3O2)Purity:≥ 95.0%Color and Shape:White or almost white powderMolecular weight:839.96Palmitoyl Tripeptide-5
CAS:Formula:C33H65N5O5·2(C2HF3O2)Purity:95%~99%Color and Shape:White to Off-white PowderMolecular weight:839.96N2-(1-Oxohexadecyl)-L-lysyl-L-valyl-L-lysine 2,2,2-trifluoroacetate (1:2)
CAS:<p>Butanediol is the organic compound with the formula CH2(CH2)4O. It is a colorless liquid that is soluble in water and polar organic solvents. Butanediol is used as a solvent and a reactant in chemical synthesis, but it has also been investigated for use as a skin conditioning agent. Ganoderma lucidum extract has been shown to have antioxidant and anti-inflammatory effects on human skin cells. This extract promotes epidermal growth factor (EGF) production and collagen synthesis, which may be due to its tyrosinase-inhibiting properties. Tyrosinase activity can be inhibited by 1:2 N2-(1-oxohexadecyl)-L-lysyl-L-valyl-L-lysine 2,2,2-trifluoroacetate (1:2).</p>Formula:C33H65N5O5•(C2HF3O2)2Purity:Min. 95%Molecular weight:839.95 g/mol


