CymitQuimica logo

CAS 623172-56-5

:

N2-(1-Oxohexadecyl)-L-lysyl-L-valyl-L-lysine 2,2,2-trifluoroacetate (1:2)

Description:
N2-(1-Oxohexadecyl)-L-lysyl-L-valyl-L-lysine 2,2,2-trifluoroacetate (1:2) is a synthetic compound characterized by its complex structure, which includes a long-chain fatty acid derivative and multiple amino acid residues. The presence of the hexadecyl group suggests that it has hydrophobic properties, which may influence its solubility and interaction with biological membranes. The amino acids L-lysine and L-valine contribute to its potential biological activity, as they are essential for various physiological processes. The trifluoroacetate moiety indicates that the compound may exhibit unique chemical reactivity and stability, particularly in aqueous environments. This compound is likely to be of interest in fields such as medicinal chemistry and biochemistry, where it may serve as a model for studying peptide interactions or as a potential therapeutic agent. Its specific applications would depend on its biological activity, stability, and interaction with other biomolecules. As with any chemical substance, safety and handling precautions should be observed due to its synthetic nature and potential biological effects.
Formula:C33H65N5O5.2(C2HF3O2)
InChI:InChI=1S/C33H65N5O5.2C2HF3O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-23-29(39)36-27(21-17-19-24-34)31(40)38-30(26(2)3)32(41)37-28(33(42)43)22-18-20-25-35;2*3-2(4,5)1(6)7/h26-28,30H,4-25,34-35H2,1-3H3,(H,36,39)(H,37,41)(H,38,40)(H,42,43);2*(H,6,7)/t27-,28-,30-;;/m0../s1
InChI key:FKCOHLNFINRFFR-RROPMPDHSA-N
SMILES:CCCCCCCCCCCCCCCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCCCN)C(=O)O.C(=O)(C(F)(F)F)O.C(=O)(C(F)(F)F)O
Synonyms:
  • Pal-Kvk
Found 5 products.