CymitQuimica logo

CAS 6232-11-7

:

methyl 4-(aminomethyl)benzoate hydro-chloride

Description:
Methyl 4-(aminomethyl)benzoate hydrochloride, with the CAS number 6232-11-7, is a chemical compound that belongs to the class of benzoate esters. It is characterized by the presence of a methyl ester group and an amino group attached to a benzene ring, which contributes to its potential biological activity. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it versatile for different applications. The hydrochloride form indicates that it is a salt, which often enhances its stability and solubility. Methyl 4-(aminomethyl)benzoate hydrochloride may exhibit properties such as antimicrobial or anti-inflammatory activity, making it of interest in pharmaceutical research. Its structure allows for various chemical modifications, which can lead to derivatives with enhanced efficacy or reduced toxicity. As with many chemical substances, handling should be done with care, following appropriate safety guidelines due to potential irritant properties.
Formula:C9H11NO2・HCl
InChI:InChI=1S/C9H11NO2.ClH/c1-12-9(11)8-4-2-7(6-10)3-5-8;/h2-5H,6,10H2,1H3;1H
InChI key:GIZCKBSSWNIUMZ-UHFFFAOYSA-N
SMILES:COC(=O)C1=CC=C(C=C1)CN.Cl
Synonyms:
  • Methyl4-(aminomethyl)benzoateHCl
  • Methyl 4-(aminomethyl)benzoate hydrochloride
Found 8 products.