CAS 62333-08-8
:3-(4-hydroxy-3-methoxybenzyl)-4-{[2-(4-hydroxy-3-methoxyphenyl)-3-(hydroxymethyl)-7-methoxy-2,3-dihydro-1-benzofuran-5-yl]methyl}dihydrofuran-2(3H)-one
Description:
The chemical substance with the name "3-(4-hydroxy-3-methoxybenzyl)-4-{[2-(4-hydroxy-3-methoxyphenyl)-3-(hydroxymethyl)-7-methoxy-2,3-dihydro-1-benzofuran-5-yl]methyl}dihydrofuran-2(3H)-one" and CAS number "62333-08-8" is a complex organic compound characterized by its intricate molecular structure, which includes multiple aromatic rings and functional groups such as hydroxyl (-OH) and methoxy (-OCH3) groups. These features suggest potential biological activity, particularly in the realm of medicinal chemistry, where such compounds may exhibit antioxidant, anti-inflammatory, or anticancer properties. The presence of the dihydrofuran moiety indicates that it may also participate in various chemical reactions typical of furan derivatives. Additionally, the compound's solubility, stability, and reactivity would be influenced by its functional groups and overall molecular geometry. Its synthesis and applications could be of interest in pharmaceutical research, particularly in the development of new therapeutic agents. However, specific experimental data regarding its physical and chemical properties would be necessary for a comprehensive understanding of its behavior in various environments.
Formula:C30H32O9
InChI:InChI=1/C30H32O9/c1-35-25-11-16(4-6-23(25)32)9-20-19(15-38-30(20)34)8-17-10-21-22(14-31)28(39-29(21)27(12-17)37-3)18-5-7-24(33)26(13-18)36-2/h4-7,10-13,19-20,22,28,31-33H,8-9,14-15H2,1-3H3
SMILES:COc1cc(ccc1O)CC1C(Cc2cc3C(CO)C(c4ccc(c(c4)OC)O)Oc3c(c2)OC)COC1=O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Lappaol A
CAS:Lappaol A: antioxidant, anti-aging, boosts C. elegans lifespan/resistance via JNK-1-DAF-16, potential cancer adjuvant.Formula:C30H32O9Purity:98%Color and Shape:SolidMolecular weight:536.57Lappaol A
CAS:Lappaol A is a bioactive compound, which is a lignan derived from the roots of Arctium lappa, commonly known as burdock. This compound is characterized by its complex structure, featuring multiple phenolic groups, and is extracted through sophisticated chromatographic techniques to ensure high purity. Lappaol A exhibits a multifaceted mode of action; it is known for its anti-inflammatory, antioxidant, and antitumor activities. These effects are mediated through the modulation of key cellular pathways, including the inhibition of NF-kB and the scavenging of reactive oxygen species, thereby attenuating oxidative stress and inflammation.Formula:C30H32O9Purity:Min. 95%Molecular weight:536.6 g/mol

