CymitQuimica logo

CAS 623565-15-1

:

3-Ethyl 5-[(4-nitrophenyl)methyl] 6,7-dihydropyrazolo[1,5-a]pyrazine-3,5(4H)-dicarboxylate

Description:
3-Ethyl 5-[(4-nitrophenyl)methyl] 6,7-dihydropyrazolo[1,5-a]pyrazine-3,5(4H)-dicarboxylate is a complex organic compound characterized by its unique pyrazolo structure, which incorporates both ethyl and nitrophenyl substituents. This compound features a dihydropyrazine core, contributing to its potential biological activity and reactivity. The presence of carboxylate groups suggests it may exhibit acidic properties, while the nitrophenyl moiety can enhance its electron-withdrawing characteristics, potentially influencing its reactivity and interactions in various chemical environments. The compound's structure indicates it may be of interest in medicinal chemistry, particularly for its potential pharmacological properties. Additionally, the presence of multiple functional groups allows for diverse chemical modifications, which can be explored for developing derivatives with enhanced efficacy or selectivity. Overall, this compound exemplifies the complexity and versatility often found in synthetic organic chemistry, making it a candidate for further research in various applications, including drug development and material science.
Formula:C17H18N4O6
InChI:InChI=1S/C17H18N4O6/c1-2-26-16(22)14-9-18-20-8-7-19(10-15(14)20)17(23)27-11-12-3-5-13(6-4-12)21(24)25/h3-6,9H,2,7-8,10-11H2,1H3
InChI key:InChIKey=SLNQMPZJSWXEGJ-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C2N(N=C1)CCN(C(OCC3=CC=C(N(=O)=O)C=C3)=O)C2
Synonyms:
  • Pyrazolo[1,5-a]pyrazine-3,5(4H)-dicarboxylic acid, 6,7-dihydro-, 3-ethyl 5-[(4-nitrophenyl)methyl] ester
  • 3-Ethyl 5-[(4-nitrophenyl)methyl] 6,7-dihydropyrazolo[1,5-a]pyrazine-3,5(4H)-dicarboxylate
Found 3 products.