
CAS 6238-47-7
:7-Amino-2-methyl-1,8-naphthyridin-4-ol
Description:
7-Amino-2-methyl-1,8-naphthyridin-4-ol, with the CAS number 6238-47-7, is a heterocyclic organic compound characterized by its naphthyridine structure, which consists of a fused bicyclic system containing nitrogen atoms. This compound features an amino group (-NH2) and a hydroxyl group (-OH) attached to the naphthyridine ring, contributing to its potential biological activity. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the hydroxyl group. The compound is of interest in medicinal chemistry, particularly for its potential applications in pharmaceuticals, as derivatives of naphthyridine have been studied for their antimicrobial, antiviral, and anticancer properties. Its chemical reactivity is influenced by the functional groups present, allowing for various synthetic modifications. Additionally, the compound's stability, melting point, and specific reactivity can vary based on environmental conditions and the presence of other chemical entities. Overall, 7-Amino-2-methyl-1,8-naphthyridin-4-ol represents a significant structure in the realm of organic and medicinal chemistry.
Formula:C9H9N3O
InChI:InChI=1S/C9H9N3O/c1-5-4-7(13)6-2-3-8(10)12-9(6)11-5/h2-4H,1H3,(H3,10,11,12,13)
InChI key:FPRARRWNHBXCFA-UHFFFAOYSA-N
SMILES:CC1=CC(=O)C2=C(N1)N=C(C=C2)N
Synonyms:- 7-Amino-2-methyl-1,8-naphthyridin-4-ol
- 1,8-Naphthyridin-4-ol, 7-amino-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
