CAS 6240-08-0
:3-Chloroadamantane-1-carboxamide
Description:
3-Chloroadamantane-1-carboxamide is a chemical compound characterized by its adamantane structure, which is a polycyclic hydrocarbon known for its stability and unique three-dimensional shape. The presence of a carboxamide functional group (-C(=O)NH2) indicates that it has both carbonyl and amine characteristics, contributing to its potential as a polar compound. The chlorine atom at the 3-position of the adamantane framework introduces additional reactivity and influences the compound's physical properties, such as solubility and boiling point. This compound may exhibit interesting biological activities, making it of interest in medicinal chemistry and drug development. Its structural features suggest that it could participate in hydrogen bonding due to the amide group, which may enhance its interactions with biological targets. Overall, 3-Chloroadamantane-1-carboxamide represents a unique combination of structural stability and functional reactivity, making it a subject of interest in various chemical research fields.
Formula:C11H16ClNO
InChI:InChI=1S/C11H16ClNO/c12-11-4-7-1-8(5-11)3-10(2-7,6-11)9(13)14/h7-8H,1-6H2,(H2,13,14)
InChI key:FMXPGWNCORDLEA-UHFFFAOYSA-N
SMILES:C1C2CC3(CC1CC(C2)(C3)Cl)C(=N)O
Synonyms:- Tricyclo[3.3.1.13,7]Decane-1-Carboxamide, 3-Chloro-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
3-Chloroadamantane-1-carboxamide
CAS:Formula:C11H16ClNOColor and Shape:SolidMolecular weight:213.7038
