CymitQuimica logo

CAS 625394-68-5

:

8-Bromo-3,4-dihydro-6-methyl-2H-1,4-benzoxazine

Description:
8-Bromo-3,4-dihydro-6-methyl-2H-1,4-benzoxazine is a chemical compound characterized by its unique bicyclic structure, which includes a benzene ring fused to a heterocyclic oxazine moiety. This compound features a bromine substituent at the 8-position and a methyl group at the 6-position, contributing to its chemical reactivity and potential applications in various fields, including medicinal chemistry and materials science. The presence of the bromine atom enhances its electrophilic character, making it a useful intermediate in organic synthesis. Additionally, the dihydro configuration indicates the presence of saturated carbon atoms, which can influence the compound's stability and reactivity. The benzoxazine structure is known for its thermal stability and ability to form polymers, making it of interest in the development of advanced materials. Overall, 8-Bromo-3,4-dihydro-6-methyl-2H-1,4-benzoxazine exhibits properties that may be exploited in various chemical reactions and applications, although specific reactivity and stability would depend on the surrounding conditions and functional groups present.
Formula:C9H10BrNO
InChI:InChI=1S/C9H10BrNO/c1-6-4-7(10)9-8(5-6)11-2-3-12-9/h4-5,11H,2-3H2,1H3
InChI key:InChIKey=JSBAIKUUINFLEM-UHFFFAOYSA-N
SMILES:BrC1=C2C(=CC(C)=C1)NCCO2
Synonyms:
  • 2H-1,4-Benzoxazine, 8-bromo-3,4-dihydro-6-methyl-
  • 8-Bromo-3,4-dihydro-6-methyl-2H-1,4-benzoxazine
Found 3 products.