CymitQuimica logo

CAS 62546-27-4

:

1-(4-bromophenyl)-3,5-dimethyl-pyrazole

Description:
1-(4-Bromophenyl)-3,5-dimethyl-pyrazole is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of a 4-bromophenyl group indicates that a bromine atom is substituted on the phenyl ring at the para position, contributing to the compound's overall reactivity and potential biological activity. The two methyl groups at the 3 and 5 positions of the pyrazole ring enhance its lipophilicity and may influence its interaction with biological targets. This compound is typically used in research settings, particularly in medicinal chemistry, due to its potential as a scaffold for developing pharmaceuticals. Its properties include moderate solubility in organic solvents and stability under standard laboratory conditions. The presence of the bromine atom can also impart unique electronic properties, making it a candidate for further functionalization or as a building block in synthetic organic chemistry. Overall, 1-(4-bromophenyl)-3,5-dimethyl-pyrazole is a versatile compound with applications in various fields, including agrochemicals and pharmaceuticals.
Formula:C11H11BrN2
InChI:InChI=1/C11H11BrN2/c1-8-7-9(2)14(13-8)11-5-3-10(12)4-6-11/h3-7H,1-2H3
InChI key:ATCMNDCOEJOOSF-UHFFFAOYSA-N
SMILES:Cc1cc(C)n(c2ccc(cc2)Br)n1
Found 5 products.