CymitQuimica logo

CAS 62577-90-6

:

Benzoic acid, 4-(cyclopropyloxy)-

Description:
Benzoic acid, 4-(cyclopropyloxy)-, is an aromatic carboxylic acid characterized by the presence of a benzoic acid moiety substituted with a cyclopropyloxy group at the para position. This compound features a cyclopropyl ring, which is a three-membered carbon ring, contributing to its unique structural and chemical properties. The presence of the carboxylic acid functional group (-COOH) imparts acidic characteristics, allowing it to participate in various chemical reactions, such as esterification and acid-base reactions. The cyclopropyloxy substituent can influence the compound's solubility, reactivity, and overall stability. Benzoic acid derivatives are often studied for their potential applications in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. Additionally, the specific arrangement of atoms in this compound may affect its biological activity and interactions with other molecules. Overall, 4-(cyclopropyloxy)benzoic acid represents a unique structure within the realm of organic chemistry, with potential implications in various fields of research and application.
Formula:C10H10O3
InChI:InChI=1S/C10H10O3/c11-10(12)7-1-3-8(4-2-7)13-9-5-6-9/h1-4,9H,5-6H2,(H,11,12)
InChI key:VUANULXCHKBPDD-UHFFFAOYSA-N
SMILES:C1CC1OC2=CC=C(C=C2)C(=O)O
Found 6 products.