CAS 6259-19-4
:3,7-Diaminodibenzothiophene-5,5-dioxide
Description:
3,7-Diaminodibenzothiophene-5,5-dioxide, with the CAS number 6259-19-4, is an organic compound characterized by its unique structure, which includes a dibenzothiophene core with two amino groups and a sulfone functional group. This compound typically appears as a solid and is known for its potential applications in organic electronics, particularly in the development of conductive polymers and dyes. The presence of amino groups enhances its reactivity, allowing for various chemical modifications, while the sulfone group contributes to its stability and solubility in polar solvents. Additionally, the compound may exhibit interesting optical properties, making it a candidate for use in photonic devices. Its synthesis often involves multi-step organic reactions, and it is important to handle it with care due to potential toxicity associated with similar aromatic amines. Overall, 3,7-Diaminodibenzothiophene-5,5-dioxide is a valuable compound in materials science and organic chemistry research.
Formula:C12H10N2O2S
InChI:InChI=1S/C12H10N2O2S/c13-7-1-3-9-10-4-2-8(14)6-12(10)17(15,16)11(9)5-7/h1-6H,13-14H2
InChI key:InChIKey=FUXZRRZSHWQAAA-UHFFFAOYSA-N
SMILES:O=S1(=O)C=2C(C=3C1=CC(N)=CC3)=CC=C(N)C2
Synonyms:- 3,7-Diaminodibenzothiophene dioxide
- 3,7-Dibenzothiophenediamine, 5,5-dioxide
- 3,7-Diaminodiphenylene sulfone
- 2,7-Diaminodiphenylenesulfone
- 3,7-Diaminodibenzothiophene-5,5-dioxide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3,7-Diaminodibenzo[b,d]thiophene 5,5-dioxide
CAS:3,7-Diaminodibenzo[b,d]thiophene 5,5-dioxideFormula:C12H10N2O2SPurity:97%Molecular weight:246.297-amino-5,5-dioxidodibenzo[b,d]thien-3-ylamine
CAS:Formula:C12H10N2O2SPurity:97%Color and Shape:SolidMolecular weight:246.2850Dibenzo[b,d]thiophene-3,7-diamine 5,5-dioxide
CAS:Dibenzo[b,d]thiophene-3,7-diamine 5,5-dioxide is a polycarboxylic acid that will fluoresce in the ultraviolet region when activated with light. It has been used as an industrial chemical and a cross-linking agent. Dibenzo[b,d]thiophene-3,7-diamine 5,5-dioxide has been shown to be effective in detergent compositions as a cross linking agent for the production of fatty acids. The compound also exhibits detergent properties by removing fatty acids from surfaces. This polycarboxylic acid is also used as a light emitter and absorber in the manufacture of particles or other components of detergents.
Formula:C12H10N2O2SPurity:Min. 95%Molecular weight:246.29 g/mol



