CAS 62595-11-3

L-Tryptophan-2,4,5,6,7-d5

Description:

L-Tryptophan-2,4,5,6,7-d5 is a deuterated form of the essential amino acid L-Tryptophan, which is crucial for protein synthesis and serves as a precursor for neurotransmitters such as serotonin and melatonin. The "d5" designation indicates that five hydrogen atoms in the molecule have been replaced with deuterium, a stable isotope of hydrogen. This modification can enhance the substance's utility in various research applications, particularly in studies involving metabolic pathways and tracer studies in biological systems. L-Tryptophan itself is characterized by its aromatic side chain, which contributes to its hydrophobic nature, and it plays a significant role in the synthesis of various bioactive compounds. The presence of deuterium can alter the physical and chemical properties slightly, such as the molecule's mass and vibrational frequencies, which can be advantageous in nuclear magnetic resonance (NMR) spectroscopy and other analytical techniques. Overall, L-Tryptophan-2,4,5,6,7-d5 is a valuable compound in biochemical research and pharmaceutical applications.

Formula: C₁₁H₇D₅N₂O₂

InChI: InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/t9-/m0/s1/i1D,2D,3D,4D,6D

InChI key: QIVBCDIJIAJPQS-HLTLGYGQSA-N

SMILES: [2H]C1=C(C(=C2C(=C1[2H])C(=C(N2)[2H])C[C@@H](C(=O)O)N)[2H])[2H]

Synonyms:

• L-(2,4,5,6,7-2H5)Tryptophan

L-Tryptophan-d5

CAS: 62595-11-3

L-Tryptophan-d5

Formula: C₁₁H₇D₅N₂O₂

Purity: 98% 98%atom%D

Molecular weight: 209.26

Ref: 54-DE3469

L-Tryptophan-D5

CAS: 62595-11-3

L-Tryptophan-D5 is the deuterated form of L-Tryptophan. L-Tryptophan (T0439) (Tryptophan) is an essential amino acid and serves as a precursor to serotonin, melatonin, and vitamin B3.

Formula: C₁₁H₁₂N₂O₂

Color and Shape: Solid

Molecular weight: 209.26

Ref: TM-TMID-1188

Tryptophan-d5

CAS: 62595-11-3

Formula: C₁₁H₇D₅N₂O₂

Molecular weight: 209.26

Ref: 4Z-T-2033

L-Tryptophan-2',4',5',6',7'-d5(indole-d5)

CAS: 62595-11-3

Purity: 98 atom % D

Color and Shape: White Solid

Molecular weight: 209.26

Ref: 3U-D1522

L-Tryptophan-D5

Controlled Product

CAS: 62595-11-3

Applications A labelled, essential amino acid.
References Goze, C., et al.: Eur. J. Pharmacol., 643, 153 (2010), Bhandare, P., et al.: J. Chem. Pharm. Res., 2, 372 (2010),

Formula: C₁₁D₅H₇N₂O₂

Color and Shape: Neat

Molecular weight: 209.26

Ref: TR-T947212

L-Tryptophan-2',4',5',6',7'-d5 (indole-d5)

CAS: 62595-11-3

Formula: C₁₁H₁₂N₂O₂

Molecular weight: 209.26

Ref: BE-MD-4700D5