CAS 62596-29-6
:Morusin
Description:
Morusin is a chemical compound classified as a flavonoid, primarily derived from the Morus species, such as mulberry trees. It is known for its potential health benefits, including antioxidant, anti-inflammatory, and anti-diabetic properties. Morusin exhibits a complex structure characterized by multiple hydroxyl groups, which contribute to its biological activity and solubility in polar solvents. The compound has garnered interest in pharmacological research due to its ability to modulate various biochemical pathways, potentially aiding in the management of metabolic disorders. Additionally, Morusin has been studied for its effects on cellular processes, including apoptosis and cell proliferation, making it a subject of interest in cancer research. Its safety profile and efficacy in therapeutic applications are still under investigation, highlighting the need for further studies to fully understand its mechanisms and potential uses in medicine. Overall, Morusin represents a promising natural product with diverse biological activities, warranting continued exploration in the fields of biochemistry and pharmacology.
Formula:C25H24O6
InChI:InChI=1S/C25H24O6/c1-13(2)5-7-17-22(29)21-19(28)12-20-16(9-10-25(3,4)31-20)24(21)30-23(17)15-8-6-14(26)11-18(15)27/h5-6,8-12,26-28H,7H2,1-4H3
InChI key:InChIKey=XFFOMNJIDRDDLQ-UHFFFAOYSA-N
SMILES:O=C1C2=C(C3=C(C=C2O)OC(C)(C)C=C3)OC(=C1CC=C(C)C)C4=C(O)C=C(O)C=C4
Synonyms:- 2-(2,4-Dihydroxyphenyl)-5-hydroxy-8,8-dimethyl-3-(3-methyl-2-buten-1-yl)-4H,8H-benzo[1,2-b:3,4-b′]dipyran-4-one
- 2-(2,4-Dihydroxyphenyl)-5-hydroxy-8,8-dimethyl-3-(3-methylbut-2-enyl)pyrano[2,3-h]chromen-4-one
- 4H,8H-Benzo(1,2-b:3,4-b')dipyran-4-one, 2-(2,4-dihydroxyphenyl)-5-hydroxy-8,8-dimethyl-3-(3-methyl-2-butenyl)-
- 4H,8H-benzo[1,2-b:3,4-b']dipyran-4-one, 2-(2,4-dihydroxyphenyl)-5-hydroxy-8,8-dimethyl-3-(3-methyl-2-buten-1-yl)-
- Morusin
- Mulberrochromene
- NSC 649220
- Tcmdc-124149
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
Morusin
CAS:Morusin exhibits antinociceptive, analgesic, anticonvulsant, antibacterial, and antitumor activities. Morusin can inhibit NF-κB and STAT3 activity, activate caspases activity, and restorate GABA level.Formula:C25H24O6Purity:95%~99%Molecular weight:420.461Morusin
CAS:Morusin shows anti-tumor, antioxidant, and anti-inflammatory properties by inhibiting STAT3, NFκB, and inducing apoptosis.Formula:C25H24O6Purity:98.68% - 99.8%Color and Shape:SolidMolecular weight:420.45Morusin
CAS:Oxygen-heterocyclic compoundFormula:C25H24O6Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:420.46Morusin
CAS:Controlled ProductStability Light Sensitive
Applications Morusin is an inhibitor of human cervical cancer stem cell growth, attenuating NF-kB activity, and initiating apoptosis.
References Wang, L. et al.: Mol. Cell. Biochem., 379, 7 (2013);Formula:C25H24O6Color and Shape:NeatMolecular weight:420.45Morusin
CAS:Morusin is a naturally occurring flavonoid compound, which is derived primarily from the root bark of Morus alba, commonly known as the mulberry tree. This bioactive substance is known for its various chemical properties and its ability to modulate several biological pathways. The compound acts primarily through the inhibition of key signaling pathways, such as the NF-κB and MAPK pathways, which are involved in inflammation and cancer progression.Formula:C25H24O6Purity:Min. 95%Color and Shape:Yellow PowderMolecular weight:420.45 g/mol








