CymitQuimica logo

CAS 6270-42-4

:

4-Piperidinecarboxamide,N,N-dimethyl-, hydrochloride (1:1)

Description:
4-Piperidinecarboxamide, N,N-dimethyl-, hydrochloride (1:1), with the CAS number 6270-42-4, is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a carboxamide functional group, indicating the presence of a carbonyl group (C=O) directly attached to a nitrogen atom. The dimethyl substitution on the nitrogen atom enhances its solubility and biological activity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it useful in various pharmaceutical applications. The compound may exhibit properties such as being a potential intermediate in organic synthesis or having specific biological activities, although detailed pharmacological data would be necessary to elucidate its specific uses. Safety data sheets should be consulted for handling and toxicity information, as with any chemical substance.
Formula:C8H16N2OClH
InChI:InChI=1S/C8H16N2O.ClH/c1-10(2)8(11)7-3-5-9-6-4-7;/h7,9H,3-6H2,1-2H3;1H
InChI key:AQEDPORECJZBIA-UHFFFAOYSA-N
SMILES:CN(C)C(=O)C1CCNCC1.Cl
Synonyms:
  • 4-Piperidinecarboxamide,N,N-dimethyl-, monohydrochloride
  • N,N-Dimethyl-4-piperidinecarboxamidehydrochloride
  • Piperidine-4-carboxylic acid dimethylamide hydrochloride
Found 4 products.