CAS 62715-83-7
:Acetamide,N,N'-(2,5-dichloro-1,4-phenylene)bis[N-acetyl-
Description:
Acetamide, N,N'-(2,5-dichloro-1,4-phenylene)bis[N-acetyl-] is an organic compound characterized by its structure, which includes a bis-acetamide functional group linked to a dichlorinated phenylene moiety. This compound features two acetamide groups attached to a central aromatic ring that has chlorine substituents at the 2 and 5 positions. The presence of chlorine atoms contributes to its potential reactivity and solubility properties, while the acetamide groups may impart specific biological or chemical activities. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The molecular structure suggests that it may exhibit hydrogen bonding capabilities due to the amide groups, influencing its physical properties such as melting point and solubility in various solvents. Additionally, the compound's CAS number, 62715-83-7, allows for easy identification and retrieval of data related to its safety, handling, and regulatory information.
Formula:C14H14Cl2N2O4
InChI:InChI=1S/C14H14Cl2N2O4/c1-7(19)17(8(2)20)13-5-12(16)14(6-11(13)15)18(9(3)21)10(4)22/h5-6H,1-4H3
InChI key:SJPBZTWPPJKLBP-UHFFFAOYSA-N
SMILES:CC(=O)N(C1=CC(=C(C=C1Cl)N(C(=O)C)C(=O)C)Cl)C(=O)C
Synonyms:- N,N’-Bisacetylaceto-2,5-Dichloro-1,4-Phenylenediamine
- ACETAMIDE, N,N'-(2,5-DICHLORO-1,4-PHENYLENE)BIS[N-ACETYL-]
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
N,N'-(2,5-Dichloro-1,4-phenylene)bis(N-acetylacetamide)
CAS:Formula:C14H14Cl2N2O4Molecular weight:345.1780
