CymitQuimica logo

CAS 62717-17-3

:

6,7-Dichloro-2,3-dihydro-2-benzofurancarboxylic acid

Description:
6,7-Dichloro-2,3-dihydro-2-benzofurancarboxylic acid is a chemical compound characterized by its unique structure, which includes a benzofuran moiety with two chlorine substituents at the 6 and 7 positions and a carboxylic acid functional group. This compound typically appears as a solid at room temperature and is soluble in organic solvents, though its solubility in water may be limited due to the presence of the hydrophobic benzofuran ring. The dichloro substitution can influence its reactivity and biological activity, making it of interest in various fields, including medicinal chemistry and agrochemicals. The presence of the carboxylic acid group suggests potential for hydrogen bonding and reactivity in acid-base reactions. Additionally, the compound may exhibit specific pharmacological properties, which could be explored in drug development or as a biochemical probe. Safety data should be consulted for handling and usage, as halogenated compounds can pose environmental and health risks.
Formula:C9H6Cl2O3
InChI:InChI=1S/C9H6Cl2O3/c10-5-2-1-4-3-6(9(12)13)14-8(4)7(5)11/h1-2,6H,3H2,(H,12,13)
InChI key:InChIKey=ZOIUTQJATWHPMK-UHFFFAOYSA-N
SMILES:ClC1=C2C(CC(C(O)=O)O2)=CC=C1Cl
Synonyms:
  • 6,7-Dichloro-2,3-dihydro-2-benzofurancarboxylic acid
  • 2-Benzofurancarboxylic acid, 6,7-dichloro-2,3-dihydro-
Found 1 products.