CymitQuimica logo

CAS 6272-18-0

:

N-(5,6,7,8-tetrahydronaphthalen-1-yl)acetamide

Description:
N-(5,6,7,8-tetrahydronaphthalen-1-yl)acetamide, with the CAS number 6272-18-0, is an organic compound characterized by its amide functional group attached to a tetrahydronaphthalene moiety. This compound features a naphthalene ring system that has been partially saturated, contributing to its unique structural properties. The presence of the acetamide group indicates that it can participate in hydrogen bonding, which may influence its solubility and reactivity. Typically, compounds like this may exhibit moderate polarity due to the combination of hydrophobic naphthalene and hydrophilic amide functionalities. Its potential applications could span various fields, including pharmaceuticals and materials science, where such structural motifs are often explored for their biological activity or as intermediates in synthetic pathways. The stability and reactivity of N-(5,6,7,8-tetrahydronaphthalen-1-yl)acetamide can be influenced by factors such as temperature, pH, and the presence of other chemical species.
Formula:C12H15NO
InChI:InChI=1/C12H15NO/c1-9(14)13-12-8-4-6-10-5-2-3-7-11(10)12/h4,6,8H,2-3,5,7H2,1H3,(H,13,14)
InChI key:NAJYMWNQSHRCGP-UHFFFAOYSA-N
SMILES:CC(=Nc1cccc2CCCCc12)O
Found 2 products.