CymitQuimica logo

CAS 6272-45-3

:

(2E)-3-(4-(benzyloxy)phenyl)prop-2-enoic acid

Description:
(2E)-3-(4-(benzyloxy)phenyl)prop-2-enoic acid, with the CAS number 6272-45-3, is an organic compound characterized by its structure, which features a prop-2-enoic acid backbone substituted with a benzyloxy group on a phenyl ring. This compound typically exhibits properties associated with both aromatic and carboxylic acid functionalities, including potential solubility in organic solvents and moderate polarity due to the carboxylic acid group. The presence of the benzyloxy moiety can influence its reactivity and interactions, making it a candidate for various chemical reactions, such as esterification or coupling reactions. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical applications. Its stability and reactivity can be affected by environmental conditions such as pH and temperature. Overall, this compound's unique structural features contribute to its potential utility in organic synthesis and medicinal chemistry.
Formula:C16H13O3
InChI:InChI=1/C16H14O3/c17-16(18)11-8-13-6-9-15(10-7-13)19-12-14-4-2-1-3-5-14/h1-11H,12H2,(H,17,18)/p-1/b11-8+
InChI key:HCMSDYVKYZIYGA-DHZHZOJOSA-N
SMILES:C1=CC=C(C=C1)COC2=CC=C(C=C2)/C=C/C(=O)O
Synonyms:
  • (E)-4-Benzyloxycinnamic acid
  • (2E)-3-[4-(benzyloxy)phenyl]prop-2-enoate
  • 4-Benzyloxycinnamic Acid
  • 3-[4-(Benzyloxy)Phenyl]Acrylic Acid
Found 4 products.