CymitQuimica logo

CAS 62739-04-2

:

Benzeneacetonitrile, a-(hydroxymethylene)-3-(trifluoromethyl)-

Description:
Benzeneacetonitrile, α-(hydroxymethylene)-3-(trifluoromethyl)-, with the CAS number 62739-04-2, is an organic compound characterized by its unique functional groups and structure. It features a benzene ring substituted with a trifluoromethyl group and an acetonitrile moiety, along with a hydroxymethylene group. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of the trifluoromethyl group enhances its chemical stability and lipophilicity, making it a valuable building block in medicinal chemistry. Additionally, the hydroxymethylene group can participate in various chemical reactions, such as condensation and nucleophilic addition, further expanding its utility in synthetic pathways. As with many organic compounds, safety precautions should be taken when handling this substance, as it may pose health risks if ingested or inhaled.
Formula:C10H6F3NO
InChI:InChI=1S/C10H6F3NO/c11-10(12,13)9-3-1-2-7(4-9)8(5-14)6-15/h1-4,6,15H/b8-6+
InChI key:UUHQFPZKTAMWSO-SOFGYWHQSA-N
SMILES:C1=CC(=CC(=C1)C(F)(F)F)/C(=C/O)/C#N
Found 1 products.