CymitQuimica logo

CAS 627531-40-2

:

Benzene, 2-methoxy-1-nitro-3-(trifluoromethyl)-

Description:
Benzene, 2-methoxy-1-nitro-3-(trifluoromethyl)-, also known by its CAS number 627531-40-2, is an organic compound characterized by a benzene ring substituted with a methoxy group, a nitro group, and a trifluoromethyl group. The presence of the methoxy group (-OCH3) introduces an electron-donating effect, while the nitro group (-NO2) is a strong electron-withdrawing group, influencing the compound's reactivity and polarity. The trifluoromethyl group (-CF3) is known for its strong electronegativity and can significantly affect the compound's physical and chemical properties, such as solubility and stability. This compound is likely to exhibit unique characteristics in terms of its reactivity, making it of interest in various chemical applications, including synthesis and material science. Its specific interactions and behavior in chemical reactions would depend on the functional groups' positions and the overall molecular structure, which can influence its applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis.
Formula:C8H6F3NO3
InChI:InChI=1S/C8H6F3NO3/c1-15-7-5(8(9,10)11)3-2-4-6(7)12(13)14/h2-4H,1H3
InChI key:UZQBIPDAXBSVOV-UHFFFAOYSA-N
SMILES:COC1=C(C=CC=C1[N+](=O)[O-])C(F)(F)F
Found 3 products.