CAS 62778-19-2
:1,3-Dichloro-2-iodo-5-nitrobenzene
Description:
1,3-Dichloro-2-iodo-5-nitrobenzene is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two chlorine atoms, one iodine atom, and one nitro group. The presence of these substituents significantly influences its chemical properties and reactivity. The chlorine and iodine atoms are halogens, which can enhance the compound's electrophilic character, making it more reactive in nucleophilic substitution reactions. The nitro group, being a strong electron-withdrawing group, further increases the acidity of the hydrogen atoms on the benzene ring and can also affect the compound's solubility in various solvents. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its physical properties, such as melting point and boiling point, are influenced by the molecular weight and the nature of the substituents. Safety precautions should be taken when handling this compound, as it may pose health risks due to its halogenated and nitro functionalities.
Formula:C6H2Cl2INO2
InChI:InChI=1S/C6H2Cl2INO2/c7-4-1-3(10(11)12)2-5(8)6(4)9/h1-2H
InChI key:InChIKey=FCDBEIIBODDDEJ-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=CC(Cl)=C(I)C(Cl)=C1
Synonyms:- 1,3-Dichloro-2-Iodo-5-Nitrobenzene
- 3,5-Dichloro-4-iodonitrobenzene
- 4-Iodo-3,5-dichloronitrobenzene
- Benzene, 1,3-dichloro-2-iodo-5-nitro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1,3-Dichloro-2-iodo-5-nitrobenzene
CAS:Formula:C6H2Cl2INO2Purity:>99.0%(GC)Color and Shape:Light orange to Yellow to Green powder to crystalMolecular weight:317.891,3-Dichloro-2-Iodo-5-Nitrobenzene
CAS:1,3-Dichloro-2-Iodo-5-NitrobenzeneFormula:C6H2Cl2INO2Purity:99%Molecular weight:317.91,3-Dichloro-2-iodo-5-nitrobenzene
CAS:Formula:C6H2Cl2INO2Purity:%Color and Shape:SolidMolecular weight:317.89613,5-Dichloro-4-iodonitrobenzene
CAS:Formula:C6H2Cl2INO2Purity:95+%Color and Shape:SolidMolecular weight:317.891,3-Dichloro-2-iodo-5-nitrobenzene
CAS:1,3-Dichloro-2-iodo-5-nitrobenzene is a nucleophilic reagent that can react with a variety of functional groups. It reacts with carbanionic compounds, such as sulphoxides, to form the corresponding chloroformates. This compound is used in the synthesis of organic compounds. 1,3-Dichloro-2-iodo-5-nitrobenzene has been used in the kinetic study of reactions between hydrazine and ammonia or methylamine, and it efficiently reacts with methanol to form methyl nitrosourea. 1,3-Dichloro-2-iodo-5-nitrobenzene is also a useful nucleophile for the synthesis of anionically stabilized carbonyl compounds from aromatic systems. This reagent reacts with electron rich aromatic systems to form electrophilic aromatic substituents that are less susceptible to nucleophilic attackFormula:C6H2Cl2INO2Purity:Min. 95%Molecular weight:317.89 g/mol




